answersLogoWhite

0

What is the chemical formula for 2-methyl-2hexene?

User Avatar

Anonymous

∙ 15y ago
Updated: 8/18/2019

A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.

User Avatar

Wiki User

∙ 15y ago
Copy

What else can I help you with?

Related Questions

What is the formula for chemical energy?

Energy has no chemical formula as it is not a chemical.


What is the chemical name for formula?

chemical formula


The chemical formula for glucose is?

The chemical formula for glucose is C6H12O6.


What is the chemical formula for a ribose?

the chemical formula for a ribose is C12H22O11.


What is the chemical formula of mannose?

The chemical formula of mannose is C6H12O6.


What is the chemical formula for CF?

The chemical formula for CF is carbon monofluoride.


What is the chemical formula for Fructos?

The chemical formula for Fructose is C6H12O6


What is the chemical formula for SnCl4?

That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.


What is the chemical formula of Rb and N?

The rubidium nitride has the chemical formula Rb3N.


What is the chemical formula for ethanal?

The chemical formula of ethanal (acetic aldehyde) is CH3CHO.


What is a chemical formula for glucose?

The chemical formula for glucose is C6H12O6.


What is the chemical formula for benzine?

the chemical formula is C6H6 that is according to my data

Trending Questions
Are all scientific discoveries as result of research? Where is the transmission drain plug on a 2004 Chrysler Sebring? If a truck weights 4000 pounds how many tons is the truck? Who is Agnes in Catherine Called Birdy? How do reset the security system for a Ford 2001 Explorer Sport Trac? What are some innovative cat feeding toys that can help stimulate my cat's mind and encourage healthy eating habits? Why did Christopher Columbus travel to America? What is the difference between a fundamental and derived quantity? What is it meant by state? How do you replace the water pump on a 1998 Cadillac DeVille? Is it illegal to print an eBook for personal use? How long does it take to travel by plane from Boston to Cuba? Can you put the word portend in a sentence? What song did the British soldiers sing? What is the stimulus for red cell production? Is pleb a swear word? What does the name Penny mean in the bible? What happens to copper sulphate when heated? A heavenly body that orbits a planet? What does a g35 compression rod look like?

Resources

Leaderboard All Tags Unanswered

Top Categories

Algebra Chemistry Biology World History English Language Arts Psychology Computer Science Economics

Product

Community Guidelines Honor Code Flashcard Maker Study Guides Math Solver FAQ

Company

About Us Contact Us Terms of Service Privacy Policy Disclaimer Cookie Policy IP Issues
Answers Logo
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.