answersLogoWhite

0

What is the chemical formula for 2-methyl-2hexene?

User Avatar

Anonymous

∙ 16y ago
Updated: 8/18/2019

A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.

User Avatar

Wiki User

∙ 16y ago
Copy

What else can I help you with?

Related Questions

What is the formula for chemical energy?

Energy has no chemical formula as it is not a chemical.


What is a chemical formula for glucose?

The chemical formula for glucose is C6H12O6.


What is the chemical formula for ethanal?

The chemical formula of ethanal (acetic aldehyde) is CH3CHO.


What is the chemical formula for SnCl4?

That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.


What is the chemical formula of Rb and N?

The rubidium nitride has the chemical formula Rb3N.


The chemical formula for glucose is?

The chemical formula for glucose is C6H12O6.


What is the chemical formula for a ribose?

the chemical formula for a ribose is C12H22O11.


What is the chemical formula of mannose?

The chemical formula of mannose is C6H12O6.


What is the chemical formula for CF?

The chemical formula for CF is carbon monofluoride.


What is the chemical formula for Fructos?

The chemical formula for Fructose is C6H12O6


What is the chemical name for formula?

chemical formula


What is the chemical formula for benzine?

the chemical formula is C6H6 that is according to my data

Trending Questions
What is the name of the Australian men's hockey team? Is France humid? How can men achieve a more feminine body through their fitness and lifestyle choices? What is the plot in the bad beginning by lemony snicket? What is matrifocal? What is the address for the headquarters of the SSPCA? How long is garlic good for before it goes bad? What does meticulousy mean? How do yoU replace drivers side mirror on a 1996 MERCEDES C280? How does Central Bank of Nigeria control the activities of all the commercial banks in Nigeria? What ribbons did marines get from beirut Lebanon? Is it possible to break an apartment lease if the landlord promised 24 hour security and gated community but neither are true? What is responsible for choosing the President and Vice-President? How many songs did Barbra Streisand write? When is ikarishipping day? What was the religion of John Rockefeller? What is it called when pollen joins the ovary? How long does it take for a woodpecker to find a suet feeder? How would you add up in step by step increments the numbers of 490 999 492 and 19 in Roman numerals showing how you obtained your answer? What is the slope of y equals -6x-5?

Resources

Leaderboard All Tags Unanswered

Top Categories

Algebra Chemistry Biology World History English Language Arts Psychology Computer Science Economics

Product

Community Guidelines Honor Code Flashcard Maker Study Guides Math Solver FAQ

Company

About Us Contact Us Terms of Service Privacy Policy Disclaimer Cookie Policy IP Issues
Answers Logo
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.