A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
Energy has no chemical formula as it is not a chemical.
The chemical formula for glucose is C6H12O6.
The chemical formula of ethanal (acetic aldehyde) is CH3CHO.
That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.
The rubidium nitride has the chemical formula Rb3N.
The chemical formula for glucose is C6H12O6.
the chemical formula for a ribose is C12H22O11.
The chemical formula of mannose is C6H12O6.
The chemical formula for CF is carbon monofluoride.
The chemical formula for Fructose is C6H12O6
chemical formula
the chemical formula is C6H6 that is according to my data