answersLogoWhite

0

What is the chemical formula for 2-methyl-2hexene?

User Avatar

Anonymous

∙ 15y ago
Updated: 8/18/2019

A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.

User Avatar

Wiki User

∙ 15y ago
Copy

What else can I help you with?

Related Questions

What is the formula for chemical energy?

Energy has no chemical formula as it is not a chemical.


What is the chemical name for formula?

chemical formula


The chemical formula for glucose is?

The chemical formula for glucose is C6H12O6.


What is the chemical formula for a ribose?

the chemical formula for a ribose is C12H22O11.


What is the chemical formula of mannose?

The chemical formula of mannose is C6H12O6.


What is the chemical formula for CF?

The chemical formula for CF is carbon monofluoride.


What is the chemical formula for Fructos?

The chemical formula for Fructose is C6H12O6


What is the chemical formula for SnCl4?

That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.


What is the chemical formula of Rb and N?

The rubidium nitride has the chemical formula Rb3N.


What is the chemical formula for ethanal?

The chemical formula of ethanal (acetic aldehyde) is CH3CHO.


What is a chemical formula for glucose?

The chemical formula for glucose is C6H12O6.


What is the chemical formula for benzine?

the chemical formula is C6H6 that is according to my data

Trending Questions
How did the Middletons get their wealth? Why water is a good solvent for ionic substances? What year was the alcan highway complete? What is the braced column? What are the release dates for Marusa no onna 2 - 1988? What term do you use for animal autopsy? What is 98 plus 2? What are the criteria for judging handwriting? Has a heart shape have symmetry? What was Lynn Margulis' religion? What year was I born if I am 63 years old? What was the name of scaramangas butler in the man with the golden gun? When did Shinobu Horie die? What age is when you can stop wearing a helmet? Why alcoholic potassium hydroxide is used for calculating saponification number of oil? Why is star wars three rated pg-13? Where is West Nile virus found in the world? Did Abraham unite the 12 tribes of Israel? How big is 144 sq in? How much do football face masks weigh?

Resources

Leaderboard All Tags Unanswered

Top Categories

Algebra Chemistry Biology World History English Language Arts Psychology Computer Science Economics

Product

Community Guidelines Honor Code Flashcard Maker Study Guides Math Solver FAQ

Company

About Us Contact Us Terms of Service Privacy Policy Disclaimer Cookie Policy IP Issues
Answers Logo
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.