0
CH3COOCH2CH2CH2CH2CH3
Wiki User
∙ 15y ago
Add your answer:
Earn +20 pts
What is the equation of the formation of 1-Pentyl Acetate?
If formed by esterification from pentanol and acetic acid it would be C5H11OH + CH3COOH (plus acid catalyst)------> C5H11OOCCH3 + H2O
Why Sec pentyl chloride is not a correct name?
Because there are two possibilities for sec. butyl chloride, 1- chlorine at 2nd carbon and 2- chlorine at 3rd carbon so the name sec. pentyl chloride is not used.
Why did you not wash the crude t-pentyl chloride with aqueous sodium hydroxide?
Because I think that t-pentyl alcohol and sodium chloride will be produced. t-penyl alcohol is also known as tert-amyl alcohol or 2-methyl-2-butanol.
The equation between 2-chloro-2-methylpropane and sodium hydroxide?
C3H7Cl + NaOH -> C3H7OH + NaCl This is a substitution reaction, OH- ion acts as a nucleophile. C-Cl bond is polar and Cl leaves as Cl- and carbon has + charge, which the OH- can attack = nucleophilic substitution reaction.
What is the chemical formula for pentyl acetate?
Formula: CH3COOC5H11
What is the condensed structural formula and name of ester for 1-pentanol and acetic acid?
This is an esterification reaction that produces pentyl ethanoate as its product. If I remember correctly, pentyl ethanoate smells of pear drops. The general rule here is that any alc1ohol will react with any alk2anoic acid to produce the corresponding ester alk1yl alk2anoate. Oh, and it's pentan-1-ol btw, not 1-pentanol.
What ester is formed when pentyl alcohol reacts with acetic acid?
The Easter formed is pentyl acetate
What is the ester formed from acetic acid and n-pentyl alcohol?
Pentyl Ethanoate The structural formula looks like this: CH3-CH2-CH2-CH2-CH2-O-C(=O)* -CH3 *The double bonded O goes on top of the C and the last CH3 is attached to the C, not the double bonded O.
What is the chemical formula for the product of 1-pentanol and acetic acid?
The reaction for 1-pentanol and acetic acid produces amyl acetate as a condensate. This ester has the chemical formula of CH3COO[CH2]4CH3.
What is the product of Acetic Acid and 2-pentanol?
2-pentyl acetate and water
What toxic substance has the odor of bananas?
Amylacetate,Amyl acetate (also pentyl ethanoate, pentyl acetate) is an Organic_compoundand an Esterwith the chemical formula CH3COO[CH2]4CH3 and the molecular weight 130.19 g/mol. It has a Scentsimilar to BananaAnswers.comand Applewhich is not detectable by all people.[Wikipedia:Citation_needed] The compound is the condensation product of Acetic_acidand 1-pentanol. However, esters formed from other pentanol isomers (Amyl_alcohol), or mixtures of pentanols, are often referred to as amyl acetate.
What is the name of the chemical formula c3h7?
This is the molecular formula for a propyl radical, which is not a stable compound, contains an unpaired electron, and has one of two different structural formulas, depending on whether a terminal or the central carbon atom has the unpaired electron nearest it.
What is the equation of the formation of 1-Pentyl Acetate?
If formed by esterification from pentanol and acetic acid it would be C5H11OH + CH3COOH (plus acid catalyst)------> C5H11OOCCH3 + H2O
What is the chemical formula for nail varnished?
A main component is acetone [propanon, CH3C(O)CH3 ], but sometimes butyl- and pentyl esters are also involved.
Why does nail polish remover smell so bad?
Alcohol I was always led to believe it is an ester called Amyl Acetate (old name) or Pentyl Ethanoate (new name) with chemical formula CH3COO[CH2]4CH3.
What is IUPAC name of tert-pentyl?
3-Methylbutyl
