0
If formed by esterification from pentanol and acetic acid it would be
C5H11OH + CH3COOH (plus acid catalyst)------> C5H11OOCCH3 + H2O
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
What is the balanced equation for lead acetate and potassium iodide producing potassium acetate and lead iodide?
Pb2+ + I- --> PbI2(s)potassium and acetate ions are left out of the equation, because they don't react (stay unchanged in solution)
Net ionic equation for sodium acetate and potassium nitrate?
sodium acetate = Na+C2H3O2- (a salt) nitric acid = HNO3 equation: NaC2H3O2 + HNO3 --> NaNO3 + C2H4O2
What is the equation for dry distillation of calcium acetate?
(ch3coo)2ca when dry distilled
What is net ionic equation for aluminum bromide and silver acetate?
It all dissolves.
What is the net ionic equation of sodium acetate and barium hydroxide?
All elements are disassociated so there is no net Ionic equation
What is the equation for sodium acetate?
C2H3NaOO
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is an acetylase?
An acetylase is an enzyme which catalyzes the formation of acetate esters.
What is the balanced equation for lead acetate and potassium iodide producing potassium acetate and lead iodide?
Pb2+ + I- --> PbI2(s)potassium and acetate ions are left out of the equation, because they don't react (stay unchanged in solution)
Equation for the ethyl acetate test?
The equation for this reaction is: CH3COOH + CH3CH2OH ------> CH3COOCH3 + H2O
What is the net ionic equation of silver acetate?
Ag+ + I- --> AgI
Net ionic equation for sodium acetate and potassium nitrate?
sodium acetate = Na+C2H3O2- (a salt) nitric acid = HNO3 equation: NaC2H3O2 + HNO3 --> NaNO3 + C2H4O2
What is the molecular equation for sodium acetate and iron chloride?
a complex compound should be formed between iron and acetate group
What is the balance equation of aluminum acetate and cooper II sulfate?
i have no clue
What is the equation for dry distillation of calcium acetate?
(ch3coo)2ca when dry distilled
What is the balanced equation of barium acetate and potassium iodide?
A reaction doesn't occur.
What is net ionic equation for aluminum bromide and silver acetate?
It all dissolves.
