answersLogoWhite

0

C2H3NaOO

User Avatar

Wiki User

13y ago

What else can I help you with?

Related Questions

What is the word equation for carbon dioxide water and sodium acetate?

The word equation for the reaction involving carbon dioxide, water, and sodium acetate is: carbon dioxide + water + sodium acetate → sodium bicarbonate.


What is the dissociation equation sodium acetate?

The dissociation equation for sodium acetate (NaCH3COO) in water would be: NaCH3COO (s) -> Na+ (aq) + CH3COO- (aq)


Sodium acetate and water chemical equation?

the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).


Net ionic equation for sodium acetate and potassium nitrate?

The net ionic equation for sodium acetate (NaCH3COO) and potassium nitrate (KNO3) is: CH3COO^- + K^+ -> KCH3COO


What is the net ionic equation of sodium acetate and barium sulfide?

The net ionic equation for sodium acetate (NaC2H3O2) and barium sulfide (BaS) is: Ba2+(aq) + 2CH3COO-(aq) -> Ba(CH3COO)2(s) This equation shows the formation of insoluble barium acetate precipitate.


What is the net iconic equation for sodium acetate and silver nitrate?

The net ionic equation for the reaction between sodium acetate (NaCH3COO) and silver nitrate (AgNO3) is: CH3COO- + Ag+ -> AgCH3COO. This simplified equation highlights the formation of a precipitate of silver acetate (AgCH3COO) when silver ions (Ag+) react with acetate ions (CH3COO-).


What is the balanced molecular equation for sodium acetate and silver nitrate?

The balanced molecular equation for the reaction between sodium acetate (NaC2H3O2) and silver nitrate (AgNO3) is: 2NaC2H3O2 + AgNO3 -> 2AgC2H3O2 + NaNO3


What is word equation of sodium bicarbonate?

The word equation for sodium bicarbonate is: sodium bicarbonate (sodium hydrogen carbonate) + acetic acid (vinegar) → water + carbon dioxide + sodium acetate.


What is the molecular equation for sodium acetate and iron chloride?

a complex compound should be formed between iron and acetate group


What is the Net ionic equation sodium acetate and silver nitrate?

The net ionic equation for the reaction between sodium acetate (NaC2H3O2) and silver nitrate (AgNO3) is: CH3COONa(aq) + AgNO3(aq) → AgCH3COO(s) + NaNO3(aq)


Zinc acetate react with sodium phosphate?

When zinc acetate reacts with sodium phosphate, a double displacement reaction occurs. The zinc ions will combine with the phosphate ions to form zinc phosphate, while the sodium ions will combine with the acetate ions to form sodium acetate. The balanced chemical equation for this reaction is: Zn(CH₃COO)₂ + Na₃PO₄ → Zn₃(PO₄)₂ + 3NaCH₃COO.


what is the balanced equation of Sodium Acetate and Sulfuric Acid?

2CH3COONa+H2SO4 ---> 2CH3COOH+Na2SO4