answersLogoWhite

0

the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).

User Avatar

Wiki User

13y ago

What else can I help you with?

Related Questions

What is the word equation for carbon dioxide water and sodium acetate?

The word equation for the reaction involving carbon dioxide, water, and sodium acetate is: carbon dioxide + water + sodium acetate → sodium bicarbonate.


Equation for combination of acetic acid-water-chloroform with sodium hydroxide?

The reaction of acetic acid and sodium hydroxide will form sodium acetate and water. The chloroform is not involved in the reaction and will remain unchanged. The balanced chemical equation for the reaction is: CH3COOH (acetic acid) + NaOH (sodium hydroxide) -> CH3COONa (sodium acetate) + H2O (water)


What is the dissociation equation sodium acetate?

The dissociation equation for sodium acetate (NaCH3COO) in water would be: NaCH3COO (s) -> Na+ (aq) + CH3COO- (aq)


What is the chemical equation of ethanoic acid reacting with sodium hydroxide?

The chemical equation for the reaction between ethanoic acid (acetic acid) and sodium hydroxide is: CH3COOH + NaOH → CH3COONa + H2O This reaction is a neutralization reaction that forms sodium acetate and water.


What is equation for sodium hydroxide and acetic acid?

The reaction between sodium hydroxide (NaOH) and acetic acid (CH3COOH) forms sodium acetate (CH3COONa) and water (H2O). The balanced chemical equation is: CH3COOH + NaOH -> CH3COONa + H2O.


What is the chemical equation for sodium acetate with water amd acetic acid?

Any chemical reaction; a solution is obtained, containing ions as Na+ and the carboxy group -COOH.


What are some Chemical equations for oxidation of sodium acetate?

Sodium Acetate Can be fond in 2 forms. Either anhydrous or trihydrate. Oxidation reaction with anhydrous form is easier than trihydrate form. First form has reaction similar to that of Oxidation of Acetic Acid. Trihydrate form is a bit more complex and I'm still loking into it


What is word equation of sodium bicarbonate?

The word equation for sodium bicarbonate is: sodium bicarbonate (sodium hydrogen carbonate) + acetic acid (vinegar) → water + carbon dioxide + sodium acetate.


Is the reaction between Sodium acetate and water a chemical reaction?

No, it is simply the water dissolving the sodium acetate, which is a physical change. There is a physical change when you introduce a seed crystal to the sodium acetate as the bonds in the chemical become different to form a solid. By adding water, you are just dissolving it and then allowing it to become supersaturated through heating.


What is the balance chemical equation of sodium and water?

The balanced chemical equation for the reaction of sodium with water is: 2Na + 2H2O -> 2NaOH + H2


What is the reaction for Sodium acetate plus H2O?

The reaction between sodium acetate and water is a dissolution process where sodium acetate dissociates into its ions (sodium and acetate) when placed in water. The equation for this process is: CH3COONa + H2O → CH3COO- + Na+ + H2O


Is sodium acetate soluble or insoluble in water?

Sodium acetate is soluble in water.