answersLogoWhite

0

No, it is simply the water dissolving the sodium acetate, which is a physical change. There is a physical change when you introduce a seed crystal to the sodium acetate as the bonds in the chemical become different to form a solid. By adding water, you are just dissolving it and then allowing it to become supersaturated through heating.

User Avatar

Wiki User

16y ago

What else can I help you with?

Related Questions

What is the reaction between acetyl chloride and sodium acetate?

The reaction between acetyl chloride and sodium acetate would likely result in the formation of acetic anhydride and sodium chloride. Acetyl chloride would react with the sodium acetate to form acetic anhydride, along with sodium chloride as a byproduct.


Sodium acetate and water chemical equation?

the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).


What is the chemical reaction between sodium acetate and sodium hydroxide?

When sodium acetate reacts with sodium hydroxide, a double displacement reaction occurs. The products of the reaction are sodium hydroxide and sodium acetate. The balanced chemical equation for this reaction is: CH3COONa + NaOH → CH3COONa + NaOH


What is the chemical equation of ethanoic acid reacting with sodium hydroxide?

The chemical equation for the reaction between ethanoic acid (acetic acid) and sodium hydroxide is: CH3COOH + NaOH → CH3COONa + H2O This reaction is a neutralization reaction that forms sodium acetate and water.


What are some Chemical equations for oxidation of sodium acetate?

Sodium Acetate Can be fond in 2 forms. Either anhydrous or trihydrate. Oxidation reaction with anhydrous form is easier than trihydrate form. First form has reaction similar to that of Oxidation of Acetic Acid. Trihydrate form is a bit more complex and I'm still loking into it


What is the name for the chemical formula NaOCOCH3?

The chemical formula NaOCOCH3 represents sodium acetate.


What is the chemical reaction when vinegar and 0.1 M NaOHis mixed?

This is a neutralization reaction; sodium acetate is obtained.


What is the reaction of calcium acetate and sodium carbonate?

The reaction between calcium acetate and sodium carbonate will produce calcium carbonate and sodium acetate. This is a double displacement reaction where the cations and anions switch partners.


What is the reaction between sodium acetate and perchloric acid?

The reaction between sodium acetate and perchloric acid would result in the formation of acetic acid and sodium perchlorate. The balanced chemical equation for the reaction is: CH3COONa + HClO4 → CH3COOH + NaClO4


What is NaAc compound?

NaAc is the chemical formula for sodium acetate, a salt commonly used in various industries such as food, pharmaceuticals, and textiles. It is also used in heating pads as it has the ability to retain and release heat. Sodium acetate is typically produced by the reaction between acetic acid and sodium hydroxide.


What is sodium acetate made?

Sodium acetate is typically produced by the reaction of acetic acid with sodium hydroxide or sodium carbonate. This reaction forms sodium acetate and water. The compound can also be obtained from the reaction of sodium hydroxide with acetic anhydride.


What is the reaction between ascetic acid and sodium acetate?

Any reaction occur in this case.