0
What else can I help you with?
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the equation for sodium with water produces sodium hydroxide and hydrogen?
The chemical equation for the reaction of sodium with water to produce sodium hydroxide and hydrogen gas is: (2Na + 2H_2O \rightarrow 2NaOH + H_2)
What is the word equation for sodium plus water?
Sodium + water = Sodium hydroxide + Hydrogen . Here is the chemical eq'n 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
What is the balanced chemical equation when sodium bicarbonate breaks down into sodium oxide carbon dioxide water?
the balanced chemical equation when sodium bicarbonate breaks down into sodium oxide carbon dioxide water is represented as follows.2 NaHCO3(s) CO2(g) + H2O(g) + Na2CO3(s).
What is the general equation for water and sodium carbonate?
No chemical reaction between water and sodium carbonate, only solving of the sodium carbonate in water.
What is the chemical equation of this reaction Solid sodium chloride dissolves in water.?
Sodium chloride is dissociated in water: NaCl---------------------Na+ + Cl-
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the equation for sodium with water produces sodium hydroxide and hydrogen?
The chemical equation for the reaction of sodium with water to produce sodium hydroxide and hydrogen gas is: (2Na + 2H_2O \rightarrow 2NaOH + H_2)
What Is The Chemical Equation For sodium oxide combines with water to make sodium hydroxide?
Na2O + H2O -> 2NaOH
What is the word equation for sodium plus water?
Sodium + water = Sodium hydroxide + Hydrogen . Here is the chemical eq'n 2Na(s) + 2H2O(l) = 2NaOH(aq) + H2(g)
What is the balanced chemical equation when sodium bicarbonate breaks down into sodium oxide carbon dioxide water?
the balanced chemical equation when sodium bicarbonate breaks down into sodium oxide carbon dioxide water is represented as follows.2 NaHCO3(s) CO2(g) + H2O(g) + Na2CO3(s).
What is the general equation for water and sodium carbonate?
No chemical reaction between water and sodium carbonate, only solving of the sodium carbonate in water.
What is the net ionic equation for sodium hydroxide dissolve?
Dissolving is not a chemical reaction; any chemical equation.
What is the word equasion for sodium in water?
sodium and water =sodium + water -> sodium hydroxide + hydrogen and this is the right answer because i got it of a scientist
How do you balance Sodium hydrogen carbonate equals sodium carbonate plus carbon dioxide plus water?
To balance the chemical equation for the reaction between sodium hydrogen carbonate and hydrochloric acid, you need to ensure that the number of atoms for each element is equal on both sides of the equation. In this case, the balanced equation is: 2NaHCO3 + 2HCl -> 2NaCl + CO2 + 2H2O. This equation shows that two molecules of sodium hydrogen carbonate react with two molecules of hydrochloric acid to produce two molecules of sodium chloride, carbon dioxide, and two molecules of water.
Why To balance a chemical equation can we change the formulae of either reactants or products?
if it is a redox reaction sometimes you can add water to help balance the equation
What is the ionic equation for sodium reacted with water?
A chemical equation shows the reactants and products of a chemical reaction. When NaCl is placed in water, it dissolves--physical process. No chemical reaction takes place. As such, there is no chemical equation for NaCl when it is placed in water.is that it?i dont think so....
