0
What else can I help you with?
What happens when you mix Sodium Acetate with NaOH?
When Sodium Acetate is mixed with NaOH, a double displacement reaction occurs, leading to the formation of water and sodium hydroxide, along with sodium acetate. The reaction can be represented as follows: CH3COONa + NaOH → CH3COONa + H2O The sodium acetate remains in the solution, while water and sodium hydroxide are formed as byproducts.
What is the product of a reaction that take place when sodium oxide combines with water?
The reaction between sodium oxide (Na2O) and water (H2O) forms sodium hydroxide (NaOH). The chemical equation for this reaction is: Na2O + H2O -> 2NaOH
What is the formula for sodium ethanoate?
CH3COOH + NaOH -----> CH3COONa + H2O(Ethanoic acid) (Sodium hydroxide) (Sodium Acetate) (Water)
What is the reaction between sodium carbonate with vinegar?
Sodium carbonate (NaCO3) and any acid makes carbonic acid, H2CO3, which is water and carbon dioxide. The carbonic acid molecule breaks up with the water staying in the beaker and the CO2 escaping as a gas. The formula with acetic acid would be: NaCO3 + 2 H3CCOOH ---> H2CO3 + 2 H3CCOO- + 2 Na+ ---> H2O + CO2 + 2 H3CCOO- + 2 Na+ Rearranging the above to explain each step in the exchange of energy equation we get the following: NaCO3 + 2 H3CCOOH1 molecule of Sodium Carbonate plus 2 molecules of Acetic acid--->generatesH2CO3 + 2 H3CCOO- + 2 Na+Carbonic acid plus Sodium acetate--->which decomposes toH2O + CO2 + 2 H3CCOO- + 2 Na+Water plus Carbon Dioxide plus Sodium acetate The Sodium acetate is in solution and is only formed by boiling off the excess water; this is why it is shown as the two ions that comprise it.
What is meant by Sodium acetate is a basic salt?
Sodium acetate is called a basic salt because a solution of it in initially pure water has a pH value well above the neutral value of 7. This occurs because acetate ions when dissolved in water must come to an equilibrium in the ionic reaction C2H3O2-1 + H2O <-> C2H4O2 + OH-1 and sodium ions when dissolved in water must come to an equilibrium in the ionic reaction Na+1 + H2O <-> NaOH + H+1. Additionally, water itself must maintain an equilibrium in the ionic reaction H2O <-> H+1 + OH-1. The values of these three equilibrium constants are such that the net result is a higher concentration of hydroxide ions than of hydrogen ions in a solution of sodium acetate. These relative concentrations of hydroxide and hydrogen ions is the defining characteristic of a basic (or alkaline) aqueous solution: Such a relative concentration of hydroxide and of hydrogen ions, although not all the other characteristics of a sodium acetate solution, could be achieved by dissolving an appropriate amount of the base sodium hydroxide in initially pure water.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What happens when you mix Sodium Acetate with NaOH?
When Sodium Acetate is mixed with NaOH, a double displacement reaction occurs, leading to the formation of water and sodium hydroxide, along with sodium acetate. The reaction can be represented as follows: CH3COONa + NaOH → CH3COONa + H2O The sodium acetate remains in the solution, while water and sodium hydroxide are formed as byproducts.
Sodium acetate from glacial acetic acid?
To prepare sodium acetate from glacial acetic acid, you can first neutralize the glacial acetic acid with sodium hydroxide. The reaction will yield sodium acetate and water. Afterward, you can evaporate the water to obtain solid sodium acetate crystals.
What are the products of the reaction between acetic acid and sodium hydroxide?
the products are CH3COOH + NaOH ------CH3COONa + H2O
What is the chemical reaction of acetic acid plus sodium sulfite?
The chemical reaction between acetic acid (CH3COOH) and sodium sulfite (Na2SO3) results in the formation of sodium acetate (CH3COONa), sodium bisulfite (NaHSO3), and water (H2O). The balanced chemical equation for this reaction is: 2CH3COOH + Na2SO3 → 2CH3COONa + NaHSO3 + H2O. This reaction is a double displacement reaction where the cations and anions of the reactants switch places to form the products.
Equation for combination of acetic acid-water-chloroform with sodium hydroxide?
The reaction of acetic acid and sodium hydroxide will form sodium acetate and water. The chloroform is not involved in the reaction and will remain unchanged. The balanced chemical equation for the reaction is: CH3COOH (acetic acid) + NaOH (sodium hydroxide) -> CH3COONa (sodium acetate) + H2O (water)
Mixing acetone and sodium hydroxide?
oxidation-reductionWhat type of a reaction occurs when a sodium hydroxide solution is mixed with an acetic acid solution?The answer above is wrong. The correct answer is acid-base neutralization
What is the reaction between acetic acid and hydrofluoric acid?
When acetic acid reacts with hydrofluoric acid, they undergo an acid-base reaction to form water and a salt called sodium acetate. The equation for the reaction is CH3COOH (acetic acid) + HF (hydrofluoric acid) → H2O (water) + NaC2H3O2 (sodium acetate).
What salt is made if ethanoic acid reacts with sodium hydroxide?
Sodium ethanoate , archaically or commercially sodium acetate. CH3COOH + NaOH = CH3COO^-Na^(+) + H2O.
What is the reaction of acetic acid with a base?
Acetic acid reacts with a base to form water and a salt called sodium acetate. This reaction is a neutralization reaction where the hydrogen ion from the acid combines with the hydroxide ion from the base to form water.
How much vinegar is needed for making sodium acetate?
The chemical reaction for the preparation of sodium acetate is: CH3COOH + NaHCO3 → CH3COONa + H2O + CO2 Now you need to calculate the quantities from the molecular masses; it is not complicate.
What is equation for sodium hydroxide and acetic acid?
The reaction between sodium hydroxide (NaOH) and acetic acid (CH3COOH) forms sodium acetate (CH3COONa) and water (H2O). The balanced chemical equation is: CH3COOH + NaOH -> CH3COONa + H2O.
