0
What else can I help you with?
What is the word equation for carbon dioxide water and sodium acetate?
The word equation for the reaction involving carbon dioxide, water, and sodium acetate is: carbon dioxide + water + sodium acetate → sodium bicarbonate.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the net ionic equation of sodium acetate and barium sulfide?
The net ionic equation for sodium acetate (NaC2H3O2) and barium sulfide (BaS) is: Ba2+(aq) + 2CH3COO-(aq) -> Ba(CH3COO)2(s) This equation shows the formation of insoluble barium acetate precipitate.
What is the balanced molecular equation for sodium acetate and silver nitrate?
The balanced molecular equation for the reaction between sodium acetate (NaC2H3O2) and silver nitrate (AgNO3) is: 2NaC2H3O2 + AgNO3 -> 2AgC2H3O2 + NaNO3
What is the net iconic equation for sodium acetate and silver nitrate?
The net ionic equation for the reaction between sodium acetate (NaCH3COO) and silver nitrate (AgNO3) is: CH3COO- + Ag+ -> AgCH3COO. This simplified equation highlights the formation of a precipitate of silver acetate (AgCH3COO) when silver ions (Ag+) react with acetate ions (CH3COO-).
What is the equation for sodium acetate?
C2H3NaOO
What is the word equation for carbon dioxide water and sodium acetate?
The word equation for the reaction involving carbon dioxide, water, and sodium acetate is: carbon dioxide + water + sodium acetate → sodium bicarbonate.
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
Net ionic equation for sodium acetate and potassium nitrate?
The net ionic equation for sodium acetate (NaCH3COO) and potassium nitrate (KNO3) is: CH3COO^- + K^+ -> KCH3COO
What is the net ionic equation of sodium acetate and barium sulfide?
The net ionic equation for sodium acetate (NaC2H3O2) and barium sulfide (BaS) is: Ba2+(aq) + 2CH3COO-(aq) -> Ba(CH3COO)2(s) This equation shows the formation of insoluble barium acetate precipitate.
What is the balanced molecular equation for sodium acetate and silver nitrate?
The balanced molecular equation for the reaction between sodium acetate (NaC2H3O2) and silver nitrate (AgNO3) is: 2NaC2H3O2 + AgNO3 -> 2AgC2H3O2 + NaNO3
What is the net iconic equation for sodium acetate and silver nitrate?
The net ionic equation for the reaction between sodium acetate (NaCH3COO) and silver nitrate (AgNO3) is: CH3COO- + Ag+ -> AgCH3COO. This simplified equation highlights the formation of a precipitate of silver acetate (AgCH3COO) when silver ions (Ag+) react with acetate ions (CH3COO-).
What happens with dissociation in NaCl?
The equation is: NaCl----------Na++ Cl-
What is word equation of sodium bicarbonate?
The word equation for sodium bicarbonate is: sodium bicarbonate (sodium hydrogen carbonate) + acetic acid (vinegar) → water + carbon dioxide + sodium acetate.
What is the molecular equation for sodium acetate and iron chloride?
a complex compound should be formed between iron and acetate group
Which has higher dissociation constant NaCl or CH3CooNa?
They are very close to each other, they both dissociate completely in solution, as they both contain the sodium cation. 36g of NaCl can dissolve in 100g of H_2_0 and 50.4g of NaCH_3_COO can dissolve in 100g of H_2_O So Sodium acetate is slightly more soluable because it also forms a weak acid with the acetate ion, creating a buffer solution, where as sodium and chlorine do not.
What is the Net ionic equation sodium acetate and silver nitrate?
The net ionic equation for the reaction between sodium acetate (NaC2H3O2) and silver nitrate (AgNO3) is: CH3COONa(aq) + AgNO3(aq) → AgCH3COO(s) + NaNO3(aq)
