0
What is the net ionic equation of sodium acetate and barium hydroxide?
Wiki User
∙ 12y ago
All elements are disassociated so there is no net Ionic equation
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
What is the balanced chemical equation for barium nitrate and sodium hydroxide?
Ba(NO3)2 + 2NaOH → Ba(OH)2 + 2NaNO3Barium nitrate + sodium hydroxide → barium hydroxide + sodium nitrate
Why does barium nitrate in sodium hydroxide form a precipitate?
In aqueous solution, barium nitrate and sodium hydroxide undergo a double replacement reaction, in which barium ions combine with hydroxide ions to form barium hydroxide and sodium ions combine with nitrate ions to form sodium nitrate. Barium hydroxide is insoluble in water, so it precipitates out of solution. Ba(NO3)2(aq) + 2NaOH(aq) --> Ba(OH)2(s) + 2NaNO3(aq)
Will there be a gelatenous precipitate in the reaction of barium acetate and sodium carbonate?
Yes, there will be a precipitate, which is barium carbonate.
What is the chemical equation for Pyrogallic acid an sodium hydroxide?
Pyrogallic acid and sodium hydroxide is used to provide anaerobiosis.
What is the preparation for methane between sodium acetate and sodium hydroxide?
C2H3NaO2 + NaOH --> NaCO3 + CH4
What is the balanced chemical equation for barium nitrate and sodium hydroxide?
Ba(NO3)2 + 2NaOH → Ba(OH)2 + 2NaNO3Barium nitrate + sodium hydroxide → barium hydroxide + sodium nitrate
What is the name of the precipitate formed when barium chloride react with sodium hydroxide?
barium hydroxide
What does phosphorus pentoxide and barium hydroxide yield And what about phosphorus pentoxide with calcium hydroxide or sodium hydroxide?
Barium hydride
What is sodium acetate made?
Sodium acetate is obtained from the reaction of the acetic acid with sodium hydroxide, sodium carbonate, etc.
What happens when you mix sodium hydroxide and ferric chloride?
water and salt........or sodium acetate and water.....or NaCH3COO + H2O
Why does barium nitrate in sodium hydroxide form a precipitate?
In aqueous solution, barium nitrate and sodium hydroxide undergo a double replacement reaction, in which barium ions combine with hydroxide ions to form barium hydroxide and sodium ions combine with nitrate ions to form sodium nitrate. Barium hydroxide is insoluble in water, so it precipitates out of solution. Ba(NO3)2(aq) + 2NaOH(aq) --> Ba(OH)2(s) + 2NaNO3(aq)
Will there be a gelatenous precipitate in the reaction of barium acetate and sodium carbonate?
Yes, there will be a precipitate, which is barium carbonate.
What is the balance of the equation of the reaction between manganese acetate and sodium hydroxide?
Mn(CH3COO)2 + 2NaOH ----> Mn(OH)2 + 2CH3COONa
What is the equation for sodium acetate?
C2H3NaOO
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What produce basic solutions A ammonium nitrite B nitrous acid C sodium acetate D NaCl E ammonium iodide F sodium hydroxide?
sodium acetate and sodium hydroxide will produce basic solution.
In vinegar sodium hydroxide color is green.why?
A reaction occur and sodium acetate is formed.
