answersLogoWhite

0

All elements are disassociated so there is no net Ionic equation

User Avatar

Wiki User

14y ago

What else can I help you with?

Related Questions

What is the net ionic equation of sodium acetate and barium sulfide?

The net ionic equation for sodium acetate (NaC2H3O2) and barium sulfide (BaS) is: Ba2+(aq) + 2CH3COO-(aq) -> Ba(CH3COO)2(s) This equation shows the formation of insoluble barium acetate precipitate.


Equation for combination of acetic acid-water-chloroform with sodium hydroxide?

The reaction of acetic acid and sodium hydroxide will form sodium acetate and water. The chloroform is not involved in the reaction and will remain unchanged. The balanced chemical equation for the reaction is: CH3COOH (acetic acid) + NaOH (sodium hydroxide) -> CH3COONa (sodium acetate) + H2O (water)


What is the balanced chemical equation for barium nitrate and sodium hydroxide?

The balanced chemical equation for the reaction between barium nitrate and sodium hydroxide is: Ba(NO₃)₂ + 2NaOH → Ba(OH)₂ + 2NaNO₃


Sodium acetate and water chemical equation?

the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).


What is the name of the precipitate formed when barium chloride react with sodium hydroxide?

The precipitate formed when barium chloride reacts with sodium hydroxide is barium hydroxide (Ba(OH)2).


What is equation for sodium hydroxide and acetic acid?

The reaction between sodium hydroxide (NaOH) and acetic acid (CH3COOH) forms sodium acetate (CH3COONa) and water (H2O). The balanced chemical equation is: CH3COOH + NaOH -> CH3COONa + H2O.


What is sodium acetate made?

Sodium acetate is typically produced by the reaction of acetic acid with sodium hydroxide or sodium carbonate. This reaction forms sodium acetate and water. The compound can also be obtained from the reaction of sodium hydroxide with acetic anhydride.


Why does barium nitrate in sodium hydroxide form a precipitate?

In aqueous solution, barium nitrate and sodium hydroxide undergo a double replacement reaction, in which barium ions combine with hydroxide ions to form barium hydroxide and sodium ions combine with nitrate ions to form sodium nitrate. Barium hydroxide is insoluble in water, so it precipitates out of solution. Ba(NO3)2(aq) + 2NaOH(aq) --> Ba(OH)2(s) + 2NaNO3(aq)


What is the chemical equation of ethanoic acid reacting with sodium hydroxide?

The chemical equation for the reaction between ethanoic acid (acetic acid) and sodium hydroxide is: CH3COOH + NaOH → CH3COONa + H2O This reaction is a neutralization reaction that forms sodium acetate and water.


Reaction between soda lime and sodium acetate?

When soda lime (a mixture of calcium hydroxide and sodium hydroxide) comes in contact with sodium acetate, a base-acid reaction will occur. The sodium acetate will react with the hydroxide ions from the soda lime to form sodium hydroxide and acetic acid. This reaction will result in the neutralization of sodium acetate and the formation of sodium hydroxide and acetic acid as the products.


What does phosphorus pentoxide and barium hydroxide yield And what about phosphorus pentoxide with calcium hydroxide or sodium hydroxide?

Barium hydride


What is the balance of the equation of the reaction between manganese acetate and sodium hydroxide?

Mn(CH3COO)2 + 2NaOH ----> Mn(OH)2 + 2CH3COONa