0
What else can I help you with?
What is the structural formula of 2-ethyl hexane?
The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.
What is the condensed structural formula for C5H12?
CH3(CH2)3CH3 Strung out it is CH3-CH2-CH2-CH2-CH3
What is the chemical and structural formula of 4-nonene?
The formula of 4-nonene is C9H18 A representative structure would be; CH3-CH2-CH2-CH=CH-CH2-CH2-CH2-CH3
What would be the empirical formula of octane?
the structural formula for octane(straight chain) is CH3 CH2 CH2 CH2 CH2 CH2 CH2 CH3
What is 1-3-dichloro-3-methylheptane in a condensed structural formula?
CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2
What is the condensed structural formula for 1 3-dimethylcyclohexane?
The condensed structural formula for 1,3-dimethylcyclohexane is CH3-CH(CH3)-CH2-CH2-CH2-CH2.
Condense structural formula of methyl pentanoate?
The structural formula of methyl pentanoate is CH3CH2CH2CH2COOCH3.
What is propene condensed structural formula?
Ch2chch3 c=c-c
What is the structural formula of 2-ethyl hexane?
The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.
What is the condensed structural formula for 4-decene?
The condensed structural formula for 4-decene is CH3(CH2)8CH=CH2.
What is the condensed structural formula for C5H12?
CH3(CH2)3CH3 Strung out it is CH3-CH2-CH2-CH2-CH3
What is the structural formula of 3 - methylnonane?
It is a straight carbon chain composed of nine carbons with a methyl (-CH3) group attached to the third carbon. CH3-CH2-CHMe-CH2-CH2-CH2-CH2-CH2-CH3
What is the chemical and structural formula of 4-nonene?
The formula of 4-nonene is C9H18 A representative structure would be; CH3-CH2-CH2-CH=CH-CH2-CH2-CH2-CH3
What would be the empirical formula of octane?
the structural formula for octane(straight chain) is CH3 CH2 CH2 CH2 CH2 CH2 CH2 CH3
What is 1-3-dichloro-3-methylheptane in a condensed structural formula?
CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2
What is the condensed structural formula of 4ethyl 2 2dimethlyoctane?
CH3C(CH3)2CH2CH(CH2CH3)CH2CH2CH2CH3 Remember, whatever is in brackets is connected to the carbon before it.
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
