answersLogoWhite

0


Best Answer

CH2(Cl)CH2C(CH3)(CL)CH2CH3

Or C6H12Cl2

User Avatar

Wiki User

11y ago
This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: What is 1-3-dichloro-3-methylheptane in a condensed structural formula?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

What is the condensed structural formula of cyclohexane?

Cyclohexane which is a cycloalkanes, has a structural formula of C6H12. It may be written in a condensed form as (CH2)6.


How does a complete structural formula differ from condensed formula?

The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.


How does a complete structural formula differ from a condensed structural formula?

------ The condensed structural formula is simply a shortened version of the complete structural formula. -------The complete formula indicates all of the carbon and hydrogen atoms. The condenced formula groups the hydrogen atoms with each of the carbon atoms.


What is the difference between structural and condensed formula?

The structural formula show the position of atoms in a molecule.


What is the condensed structural formula of pentyl acetate?

CH3COOCH2CH2CH2CH2CH3


What is the condensed structural formula for 1-pentene?

Ch3ch3ch3hch3


What is the condensed structural formula for 4-bromo-2-pentanone?

The formula is C5H9BrO.


Draw the condensed structural formula for 3-decyne?

Ch3ch2ch2ch2ch2ch2c=-cch2ch3


What is the condensed structural formula for 2 4-Dimethylphenol?

The chemical formula of 2,4-dimethylphenol is C8H10O.


What is the condensed structural formula for methyl acetate?

H3c-c(=o)(-och3)


What is the the condensed structural formula of the compound propene?

Ch2chch3 c=c-c


Condensed structural formula of methyl propyl ether?

Ch3-o-c3h7