0
What else can I help you with?
What is structural formula of 3-oxopentanal?
The structural formula of 3-oxopentanal is CH3CH2CH2COCHO.
What is the condensed structural formula for 1 3-dimethylcyclohexane?
The condensed structural formula for 1,3-dimethylcyclohexane is CH3-CH(CH3)-CH2-CH2-CH2-CH2.
What is the structural formula for 3-heptanol?
The structural formula for 3-heptanol is CH3(CH2)5CH(OH)CH3. It has a chain of 7 carbon atoms with a hydroxyl group (OH) attached to the third carbon atom.
How does a complete structural formula differ from condensed formula?
The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.
What is the difference between structural and condensed formula?
The structural formula show the position of atoms in a molecule.
What is structural formula of 3-oxopentanal?
The structural formula of 3-oxopentanal is CH3CH2CH2COCHO.
What is the Structural formula for 3-methyl-1-butene?
structural formula of c5h10
Is the name 4-methylnonane or 2-propylheptane?
4-methylnonane since you should start naming the longest Carbon chain
What is the structural formula of 3 pentanone?
Ch3ch2coch2ch3
What is the condensed structural formula for 1 3-dimethylcyclohexane?
The condensed structural formula for 1,3-dimethylcyclohexane is CH3-CH(CH3)-CH2-CH2-CH2-CH2.
What is the structural formula for 3-heptanol?
The structural formula for 3-heptanol is CH3(CH2)5CH(OH)CH3. It has a chain of 7 carbon atoms with a hydroxyl group (OH) attached to the third carbon atom.
Structural formula of 3-chloro 2-methyl 1-butanol?
A structural formula diagram of 3-chloro-2-methyl-1-butanol would include HO with a line drawn from it. Attached to the line would be offshoots which represented the methyl and butanol.
What is the structural formula for ethyl butanoate?
The structural formula for ethyl butanoate is CH3CH2CH2COOCH2CH3.
What is the structural formula of a phosphate radical?
The structural formula of a phosphate radical is PO₄³⁻. It consists of one phosphorus atom bonded to four oxygen atoms, with a net charge of -3.
The dichloropropane structural formula and condense formula of di?
The structural formula for dichloropropane is ClCH₂CHCl₂, and its condensed formula is CH₃CHCl₂.
What is the structural formula for aspirin?
The structural formula of aspirin is HOOC-C6H4-OCOCH3(C9H8O4).
How does a complete structural formula differ from condensed formula?
The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.
