0
CH3-CH(=O)-CH(CH3)-CH2-CH3
What else can I help you with?
What are structural formula of 4-hydroxy-2pentanone?
4-hydroxy-2pentanone isCH3C(=O)CH2C(H)(OH)CH3or its optical isomer ( with (OH)(H) mirrored at 4th C atom )CH3C(=O)CH2C(OH)(H)CH3
What is meant by a structure within a structure?
A structure that is a member of another structure is a structure within a structure.
What is the difference between a matrix structure and a organisational structure?
the difference between an organisational structure and a matrix structure is that a matrix structure is a combined structure whereas an organisational structure is in a vertical order and has different levels.
Can you give a hard science question?
What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.
Differentiate the four types of protein structure?
Primary structure: The linear sequence of amino acids in a protein. Secondary structure: Local folding patterns such as alpha helices and beta sheets. Tertiary structure: Overall 3D shape of a single protein molecule. Quaternary structure: Arrangement of multiple protein subunits in a complex.
What is surface structure in engineering?
surface structure is a structure at the surface
What does structure you?
cells structure you
What is a hotel structure?
hotel structure is a structure composes of many organizations
What is capital structure decisions?
capital structure decisions are structure with decisions
What is the structure of to celia?
Celia does not have a structure. It is the only cell part that does not have a structure.
Organisational structure of reliance fresh?
reliance fresh structure reliance fresh structure reliance fresh structure
What is the difference between the structure tag and structure variable?
The structure tag is a type. The structure variable is an instance of that type.
