0
What else can I help you with?
What is the name of this compound CH3?
It is Methene.
What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?
The name of this compound is 2-chlorobutane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
3 methyl 4 chloro hexane?
3-methyl-4-chlorohexane is a compound with six carbon atoms in a chain, a chlorine atom attached to the fourth carbon, and a methyl group attached to the third carbon. It is an alkyl halide, a type of organic compound.
What is the name of the compound CH3CH2CHCH-CH3?
That's Propane. You can also express it as C3H8 .
WHAT IS THE IUPAC name of the organic compound ch3 cch-co-ch3?
PENTAN-3-EN-2-ONE
What is the name of the compound CH3CH(CH3)C(CH3)?
The compound is called 2,2,3-trimethylbutane.
What is the common name of the compound CH3 CH3?
o-diethylbenzene
What is the name of this compound CH3?
It is Methene.
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the name of the Compound CH2Br?
Ethylbromide is the name of the compound CH3-CH2-Br.
What is the name for compound CH2CH2CH3?
CH2CH2CH3 is NOT a compound name, but a 'Propyl' functional group , which would be attached to a larger molecule. Propane is CH3-CH2-CH3 Propene is CH2=CH-CH3 Propyne is HC=C-CH3 ( A triple bond). The CH2CH2CH2, is written as R-CH2CH2CH3 , the propyl functional group and 'R' the rest of the molecule.
What is name of ch3chch3ch2cho?
The name of the compound CH3CH(CH3)CH2CHO is 2-methylbutanal.
What is the name of this compound ch3ch2chch2ch2oh-ch3?
The name of this compound is 3-pentanol. It is a type of alcohol with a pentyl chain attached to the hydroxyl group on the third carbon atom.
What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?
The name of this compound is 2-chlorobutane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
