0
What else can I help you with?
What is the name of compound CH3 3?
The compound CH3 is known as methyl group. It is a functional group consisting of a carbon atom bonded to three hydrogen atoms.
What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?
The name of this compound is 2-chlorobutane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What is the name of the compound CH3CH2CHCH-CH3?
That's Propane. You can also express it as C3H8 .
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What is the name of the compound CH3CH(CH3)C(CH3)?
The compound is called 2,2,3-trimethylbutane.
What is the common name of the compound CH3 CH3?
o-diethylbenzene
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the name of compound CH3 3?
The compound CH3 is known as methyl group. It is a functional group consisting of a carbon atom bonded to three hydrogen atoms.
What is the name of the Compound CH2Br?
Ethylbromide is the name of the compound CH3-CH2-Br.
What is the name for compound CH2CH2CH3?
CH2CH2CH3 is NOT a compound name, but a 'Propyl' functional group , which would be attached to a larger molecule. Propane is CH3-CH2-CH3 Propene is CH2=CH-CH3 Propyne is HC=C-CH3 ( A triple bond). The CH2CH2CH2, is written as R-CH2CH2CH3 , the propyl functional group and 'R' the rest of the molecule.
WHAT IS THE IUPAC name of the organic compound ch3 cch-co-ch3?
PENTAN-3-EN-2-ONE
What is name of ch3chch3ch2cho?
The name of the compound CH3CH(CH3)CH2CHO is 2-methylbutanal.
What is the name of this compound ch3-ch -ch2-ch2-cl There is CL on top of CH?
The name of this compound is 2-chlorobutane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
