0
What else can I help you with?
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the chemical formula of ethyl ethanoic?
The structural formula is CH3COOCH2CH3
Condense structural formula of methyl pentanoate?
The structural formula of methyl pentanoate is CH3CH2CH2CH2COOCH3.
What is condensed formula for 2 3 3 4 tetramethylnonane?
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
What type of molecule is octanal?
Octanal - CH3(CH2)6CHO - is a type of aldehyde.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the chemical formula of ethyl ethanoic?
The structural formula is CH3COOCH2CH3
What is this C-C-C-O-C-C?
this is nothing actually is... CH3-CH2-CH2-O-CH2-CH3 ethyl methyl ether....
Condense structural formula of methyl pentanoate?
The structural formula of methyl pentanoate is CH3CH2CH2CH2COOCH3.
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the structure of 2-pentanone?
CH3-CH(=O)-CH(CH3)-CH2-CH3
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is ch3-ch2-o-ch2-ch2-ch2-ch2-ch3?
methyl propyl ether
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
