0
What else can I help you with?
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What is the name of compound CH3 3?
The compound CH3 is known as methyl group. It is a functional group consisting of a carbon atom bonded to three hydrogen atoms.
What is the name of this compound CH3?
It is Methene.
What is the molecular formula of CTAB?
[(C16H33)N(CH3)(CH3)(CH3)]BrCHEMICAL NAME - Cetyl Tri Methyl ammonium Bromide
What is the name of ch3 ch2 ch2 ch3?
The name of the compound CH3CH2CH2CH3 is butane.
What is the name for the CH3-Ch-CH3 alkyl group?
The name for the CH3-Ch-CH3 alkyl group is isopropyl.
What molecule is ch3 ch2 ch2 ch2-ch3?
One you're not too likely to run into--methanidylpropane. More common are C4H10 (propane) or C4H8 (several things, usually butadiene resin)
What is the name for ch3chch3chch3ch3?
The name for CH3CH(CH3)CH(CH3)CH3 is 2,3-dimethylpentane.
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
What is the name for the ch3-ch-ch3?
1-pentanol
What is the common name of the compound CH3 CH3?
o-diethylbenzene
What is the common name for (CH3)3CCl?
The common name for (CH3)3CCl is t-butyl chloride.
What is the name of ch3-ch2-ch2-ch2-ch-ch3 with ch3 over the ch?
The compound CH3-CH2-CH2-CH2-CH(CH3)-CH3 is known as 2-hexyl. In this structure, there is a hexane backbone with a methyl group (CH3) attached to the second carbon. The presence of the substituent gives it the specific name based on IUPAC nomenclature.
What is the name of compound CH3 3?
The compound CH3 is known as methyl group. It is a functional group consisting of a carbon atom bonded to three hydrogen atoms.
What is the name of the compound CH3CH(CH3)C(CH3)?
The compound is called 2,2,3-trimethylbutane.
What does a single straight line (-CH3) extending from an atomic symbol represent?
Single covalent bond.
