0
One you're not too likely to run into--methanidylpropane.
More common are C4H10 (propane) or C4H8 (several things, usually butadiene resin)
What else can I help you with?
What is 1-3-dichloro-3-methylheptane in a condensed structural formula?
CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
What is the structural formula of 2-ethyl hexane?
The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.
What is the condensed structural formula of 4ethyl 2 2dimethlyoctane?
CH2CH2CH3lC-C-C-C-C-ClCH3
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What is 1-3-dichloro-3-methylheptane in a condensed structural formula?
CH2(Cl)CH2C(CH3)(CL)CH2CH3 Or C6H12Cl2
How do you name this molecule ch3 ch2 ch3?
CH3-CH2-CH3 is a gas Propane.
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
What is the structural formula of 2-ethyl hexane?
The structural formula of 2-ethyl hexane is CH3(CH2)3CH(CH3)CH2CH3. It consists of an ethyl group (C2H5) attached to the second carbon atom of a hexane chain.
What is the structural formula of 3 - methylnonane?
It is a straight carbon chain composed of nine carbons with a methyl (-CH3) group attached to the third carbon. CH3-CH2-CHMe-CH2-CH2-CH2-CH2-CH2-CH3
What is the condensed structural formula of 4ethyl 2 2dimethlyoctane?
CH2CH2CH3lC-C-C-C-C-ClCH3
What is the structure for c2h6o?
C2H6O could be 1) Ethanol, CH3CH2OH 2) Dimethyl ether, CH3OCH3
What compound is CH3-CH2-CH-CH3-CH3?
It is a hydrocarbon: Butyl group. As it has 4 carbons it has prefix "but-" and it has general formula CnH2n+1 so it is part of Alkyl group. Accurately it is butyl group: CH3-CH2-CH2-CH2- Remember it has a bond protruding out from last CH2
What is the condensed formula for ethyl propanoate?
C5H10O2 Structurally CH3CH2C(=O)-O-CH2CH3 Name Ethyl propanoate (per IUPAC nomenclature).
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What is the name for this molecule ch3 ch2 ch3?
The molecule is called propane. It is a three-carbon alkane with the chemical formula C3H8.
What is the structure for octane?
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
