0
it mean to have air and to breathe through your mouth and nose . I t can also help if you have cancer or lung caner or breast caner so breathe in air lots
smoking can help to so don't listen to the doctors smoking is good for you
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
What is the scientific definition for the word respiration?
aerobic respiration in humans anaerobic respiration in plants
What happens to oxygen during aerodic respiration?
Oxygen was utilized by cellular pathways and they will be at the end converted to Carbondioxide as a waste product.
What is the process of taking in air into your body and giving it out is called?
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
What is the scientific word for respiration?
the scientific word for BREATHING is respiration P.S. u asked the question wrong :)
What is the scientific meaning of respiration?
breathing
What is the scientific definition of hair?
The scientific definition of hair is fossil fuels
What is the third step in aerodic respiration?
The third stage of aerobic respiration is the citrate cycle, which is preceded by the link reaction and glcolysis. In the citrate cycle, acetyl Co-A is oxidised in many steps (there are nine substrates in the cycle). This oxidation produced reduced co-enzymes, NADH and FADH2, which are oxidised in the electron transport chain to produce ATP from ADP and phosphate.
Is the best definition of aerobic respiration?
how are photosynthesis and celland cellular respiration similar
What is the scientific name for breathing?
Respiration is the scientific name for breathing.
What is the definition of animal respiration?
Cellular respiration is a process where animals breathe and get their oxygen from glucose.
Does the scientific definition of a hybrid match the society's definition?
no
What is the scientific definition of create?
It is the same as the Dictionary definition.
