answersLogoWhite

0

it mean to have air and to breathe through your mouth and nose . I t can also help if you have cancer or lung caner or breast caner so breathe in air lots

smoking can help to so don't listen to the doctors smoking is good for you

User Avatar

Wiki User

13y ago

What else can I help you with?

Related Questions

What happens to oxygen during aerodic respiration?

Oxygen was utilized by cellular pathways and they will be at the end converted to Carbondioxide as a waste product.


What is the scientific definition for the word respiration?

Respiration is the process by which organisms exchange gases with their environment, where oxygen is taken in and carbon dioxide is released. It involves both external respiration (breathing) and internal cellular respiration (the process of breaking down energy-rich molecules to produce ATP).


What is the scientific name for respiration?

The scientific name for respiration is "cellular respiration." It is the process by which cells break down glucose to produce energy in the form of ATP.


What is the third step in aerodic respiration?

The third stage of aerobic respiration is the citrate cycle, which is preceded by the link reaction and glcolysis. In the citrate cycle, acetyl Co-A is oxidised in many steps (there are nine substrates in the cycle). This oxidation produced reduced co-enzymes, NADH and FADH2, which are oxidised in the electron transport chain to produce ATP from ADP and phosphate.


What is the scientific name for breathing?

Respiration is the scientific name for breathing.


Is the best definition of aerobic respiration?

how are photosynthesis and celland cellular respiration similar


What is the scientific meaning of respiration?

breathing


What is the definition of animal respiration?

Cellular respiration is a process where animals breathe and get their oxygen from glucose.


What is the scientific word for respiration?

the scientific word for BREATHING is respiration P.S. u asked the question wrong :)


What is the process of taking in air into your body and giving it out is called?

Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O


Is a drawing of an atom a scientific definition?

No, a drawing of an atom is not a scientific definition. A scientific definition of an atom would describe it as the smallest unit of matter that retains the properties of an element.


Does the scientific definition of a hybrid match the society's definition?

no