0
hi this is tapasi banik from baguiati i am looking for reghistration in didi no 1 season 3 game show...please contant me soon..my contact no. is 9681573249 / 8100497602
Wiki User
∙ 12y ago
Add your answer:
Earn +20 pts
What is the number 3 sport in the world?
No1 is football played all over the world excluding USA and Canada, no2 is boxing, no3 Rugby a mans sport without padding, played in Europe, Africa and Oceania
Which Jonas Brother song lyrics are these 1 I am not the type of guy who doesn't know 2 Its time for me to open up 3 Even though she is the blonde?
No1 is "I Am What I Am" No2 is Time For Me To Fly" No3 is "Mandy" hehe that wass just too simple!!!
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
How many atoms in AL(NO3)3?
its Al + NO3 + NO3 + NO3. So one Al, three N and nine O. That makes 13 atoms.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the formula for zinc nitride?
The chemical formula for zinc nitrate is Zn(No3)2
C sharp dot net example programs for beginers?
C#.net ProgramsProgram # 1:This program takes three positive numbers from user. Compute and display the average of the two larger numbers. using System;using System.Collections.Generic;using System.Text;namespace Average_of_three_Nos{class Program{static void Main(string[] args){string no1, no2, no3;int n1, n2, n3;int average;Console.WriteLine("Enter First Number");no1 = Console.ReadLine();n1 = Int32.Parse(no1);Console.WriteLine("Enter Second Number");no2 = Console.ReadLine();n2 = Int32.Parse(no2);Console.WriteLine("Enter third Number");no3 = Console.ReadLine();n3 = Int32.Parse(no3);average = (n1 + n2 + n3) / 3;Console.WriteLine("Average of three Numbers : "+ average);}}}Program #2:This program will take two positive numbers as its input and then find GCD of them.using System;using System.Collections.Generic;using System.Text;namespace GCD{class Program{static void Main(string[] args){Program obj = new Program();string no1, no2;int n1, n2;Console.WriteLine("Enter First Number");no1 = Console.ReadLine();n1 = Int32.Parse(no1);Console.WriteLine("Enter Second Number");no2 = Console.ReadLine();n2 = Int32.Parse(no2);int g=obj.find_gcd(n1, n2);Console.WriteLine("GCD=" + g);}int find_gcd(int a, int b){int c;if(a
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is ionic character of NO3?
The ionic character of NO3 is -1.
