0
How is the process of taking in and giving out of air facilitated in breathing?
Wiki User
∙ 7y agoWant this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the physical process of taking air or water?
breathing
What is the process of taking in air into your body and giving it out is called?
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
what’s the difference between breathing and respiration?
What is the difference between breathing and respiration? Both breathing and respiration are required for all living organisms. Generally, breathing and respiration are often considered the same. However, there is a great difference between these two words. Breathing is a constant process where you breathe in and out constantly through out the day. It is a process of taking in oxygen and expelling carbon dioxide. Respiration is a process where the body breaks down the oxygen, so that the cells in the body can use it. It is a part of metabolic process also known as catabolic process of a cellular activity where energy molecule is released while carbon dioxide and water are produced. Breathing is a physical process and respiration is a chemical process. Breathing is a process of taking oxygen into the lungs while respiration is taking the oxygen from the lungs into the blood stream or to the cells.
What is the difference between cellular respiration and breathing?
respiration is process of producing energy...but breathing is just flow of air in and out of body
What 2 process can photosynthesis be separated into?
The taking in of sunlight to make sugars and starches & the taking in of carbon dioxide and the giving out of oxygen.
What is the physical process of taking in the air of water?
breathing
What is the physical process of taking in air or water?
breathing
What is the physical process of taking air or water?
breathing
What is the process of taking in oxygen and releasing carbon dioxide?
Cellular photosynthesis
What type of process is breathing'?
respitatory, taking oxygen in...and breathing carbon dioxide out. carbon dioxide=Co2 and oxygen = O
What is the difference between respiration and breathing?
What is the difference between breathing and respiration? Both breathing and respiration are required for all living organisms. Generally, breathing and respiration are often considered the same. However, there is a great difference between these two words. Breathing is a constant process where you breathe in and out constantly through out the day. It is a process of taking in oxygen and expelling carbon dioxide. Respiration is a process where the body breaks down the oxygen, so that the cells in the body can use it. It is a part of metabolic process also known as catabolic process of a cellular activity where energy molecule is released while carbon dioxide and water are produced. Breathing is a physical process and respiration is a chemical process. Breathing is a process of taking oxygen into the lungs while respiration is taking the oxygen from the lungs into the blood stream or to the cells.
What is the differances between breathing and respiration?
What is the difference between breathing and respiration? Both breathing and respiration are required for all living organisms. Generally, breathing and respiration are often considered the same. However, there is a great difference between these two words. Breathing is a constant process where you breathe in and out constantly through out the day. It is a process of taking in oxygen and expelling carbon dioxide. Respiration is a process where the body breaks down the oxygen, so that the cells in the body can use it. It is a part of metabolic process also known as catabolic process of a cellular activity where energy molecule is released while carbon dioxide and water are produced. Breathing is a physical process and respiration is a chemical process. Breathing is a process of taking oxygen into the lungs while respiration is taking the oxygen from the lungs into the blood stream or to the cells.
What is the process of taking blood from someone and giving it to another person?
transfusion
What is the process of taking in air into your body and giving it out is called?
Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O
what’s the difference between breathing and respiration?
What is the difference between breathing and respiration? Both breathing and respiration are required for all living organisms. Generally, breathing and respiration are often considered the same. However, there is a great difference between these two words. Breathing is a constant process where you breathe in and out constantly through out the day. It is a process of taking in oxygen and expelling carbon dioxide. Respiration is a process where the body breaks down the oxygen, so that the cells in the body can use it. It is a part of metabolic process also known as catabolic process of a cellular activity where energy molecule is released while carbon dioxide and water are produced. Breathing is a physical process and respiration is a chemical process. Breathing is a process of taking oxygen into the lungs while respiration is taking the oxygen from the lungs into the blood stream or to the cells.
What is the difference between cellular respiration and breathing?
respiration is process of producing energy...but breathing is just flow of air in and out of body
What 2 process can photosynthesis be separated into?
The taking in of sunlight to make sugars and starches & the taking in of carbon dioxide and the giving out of oxygen.
