0
Depends on how you look at it. There are a total of 4 atoms (1N and 3O) but there are only 2 different atoms (Nitrogen and Oxygen).
Wiki User
∙ 6y ago
Wiki User
∙ 6y agoThere are 4 atoms.
Add your answer:
Earn +20 pts
What are three nitrates that do not respond to brown ring test?
Ca(no3)2,ba(no3)2,pb(no3)2
What is No3-1?
You must mean....NO3(-) this is the polyatomic ion nitrate
How many single bonds in NO3?
(NO3)- has three single bonds.
Is NO3 a metal?
No it is a gas. There is a NO3 suppliment for working out called "Chrome" though.
When Al(NO3)3 is separated into its ions how is it written?
Al(NO3)3(aq) ===> Al^3+(aq) + 3NO3^-(aq) is how aluminum nitrate ionizes in aqueous media.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
How many atoms in AL(NO3)3?
its Al + NO3 + NO3 + NO3. So one Al, three N and nine O. That makes 13 atoms.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the formula for zinc nitride?
The chemical formula for zinc nitrate is Zn(No3)2
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is ionic character of NO3?
The ionic character of NO3 is -1.
How do you bond CA 2 WITH NO3 1- in chemistry?
We need two NO3- to cancel out Na2+: Ca(NO3)2.
Does BaCl2 and Mg NO3 2 form a precipitate?
Yes it does. BaCl2+Mg(NO3)2--->Ba(NO3)2+MgCl2
What are three nitrates that do not respond to brown ring test?
Ca(no3)2,ba(no3)2,pb(no3)2
