0
What else can I help you with?
Related Questions
What state is Mammoth Cave in?
Mammoth Cave is located in Cave City, Kentucky.
What state in the US is Mammoth Cave located in?
It is in Kentucky.
On what continent is Mammoth Cave located?
Mammoth Cave is located in the state of Kentucky, US, on the North American Continent.
The longest cave system in the world is in the US state of?
Mammoth Cave in Kentucky.
The Mammoth Cave system longest in the world is in which US state?
Kentucky.
What is the longest cave system in the US?
Mammoth Cave in Kentucky.
What is the largest cave in the US?
The Mammoth Cave is the largest cave in the United States.
What is a description of mammoth cave?
It us the biggest
The world longest cave in the us?
the longest cave is Mammoth cave it is located in Kentucky, length in miles:367.000 length in meters:590629 depth in feet:379 depth in meters:115.5
Is the US the country of Mammoth Cave?
Yes, it is in central Kentucky.
What is the longest known cave system in the world's name?
The Mammoth Cave system in Kentucky, USA, is the longest known cave system in the world, with over 400 miles of explored passageways.
The largest cave system in the world is right in the US?
yes it's Mammoth Cave system in Kentucky
Trending Questions
What peninsula did Israel seize in 1967?
How do you write vande mataram song in hinhi by ar rehman?
Can you get adult onset asthma from inhaling airbag fumes?
How do you invite people to a group on sploder?
What is the primary measure of success in a for profit organization?
Why is it silly to cook cook beans with a metal spoon?
What is the Choctaw climate?
Make a sentence using the word fill?
Since the first and second world wars turkey has been the popular choice for christmas meals in malta what bird was commonly used before the wars?
How do you get rid of the rainbow wheel on an apple cumputer?
Why is Filippo Brunelleschi considered a genius?
What do we do 12 times a day?
What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?
What is Ethnic Chauvinism?
How old do you have to be to get working papers?
Which state has a higher population density out of New Jersey and Kansas?
What are the most common websites that are viewed or logged onto daily?
What is the front leg room in the 2009 Chevrolet Malibu?
What is Accommodation Recording by a title company?
What would the world be like without recycling?
Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.