0
What else can I help you with?
Related Questions
The correct name for NO3?
NO3 is known as nitrate.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is the product of NO3 and iron II?
the equation would look like: 2(NO3) + Fe --> Fe(NO3)2 the 2 in front of the NO3 is there to balance the equation.
What the name of Al(NO3)3?
Al(NO3)3 is aluminum nitrate.
Is Fe(NO3)2 Ionic or molecular?
Fe(NO3)2 is an ionic compound. Iron (Fe) is a metal and nitrate (NO3) is a polyatomic ion, so together they form an ionic bond in Fe(NO3)2.
What is the formula of mercurous nitrate?
Hg22+ + NO3- -----> Hg2(NO3)2
Trending Questions
What is the English translation of the Italian 'bei libri'?
The prism separates sunlight into?
What does Gaura mean in Latin?
What is the name of a movie about Dobermans?
What does no attachment mean?
Who invented roti?
What was the land bridge between Tasmania and the Australian mainland called before it got flooded?
What kind of food was made at San Juan Capistrano?
Why did Chicago Bears get their name bears?
Is a speeding ticket a misdemeanor in Missouri?
Are chocalet good for our brain?
When were 7th and 8th grade students included in FFA?
Has anyone refused to play Cash Cab?
WHAT IS 500 OHM?
What is the value od pi to 20th decimal places?
What is the past tense of ribe?
What are the objectives of basic life support?
How much sodium is in Campbell's condensed broccoli cheese soup?
Which system is most closely associated with the brain?
Chatham street bulwell Nottingham 1955?
Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.