0
What else can I help you with?
Related Questions
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the product of NO3 and iron II?
the equation would look like: 2(NO3) + Fe --> Fe(NO3)2 the 2 in front of the NO3 is there to balance the equation.
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What the name of Al(NO3)3?
Al(NO3)3 is aluminum nitrate.
Is Fe(NO3)2 Ionic or molecular?
Fe(NO3)2 is an ionic compound. Iron (Fe) is a metal and nitrate (NO3) is a polyatomic ion, so together they form an ionic bond in Fe(NO3)2.
What is the formula of mercurous nitrate?
Hg22+ + NO3- -----> Hg2(NO3)2
Trending Questions
How do you use radiator stop leak?
Who gave the Pandora's box?
What do you call laughter?
What are the advantages of a algae?
What are the release dates for The Webventures of Justin and Alden - 2010?
Which counting numbers are also whole numbers?
One important difference between living things and nonliving things is that only living things have?
What is a 10000000000000000000000000000000000000000 sided shape called?
How many days does it take Saturn to revolve around the sun?
How do you pronounce cul de sac?
What is brown stuff on your underwear after a week of being off period?
What is 39.2 degrees celsius converted to Fahrenheit?
Why Don't the Amish believe in modern technology?
Name and describe the phase change that occurs when dry ice is placed in an opened container at room temperature?
Ano ang ibig sabihin ng bokasyonal?
In ways are the Earth's lithosphere and asthenosphere similar?
How developing countries do could resist globalization?
What is an example of an true conscience?
A type of barometer that records the rate of fall of the pressure in a storm?
How do you make a website and advertise it on YouTube?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.