0
What else can I help you with?
Related Questions
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the product of NO3 and iron II?
the equation would look like: 2(NO3) + Fe --> Fe(NO3)2 the 2 in front of the NO3 is there to balance the equation.
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What the name of Al(NO3)3?
Al(NO3)3 is aluminum nitrate.
Is Fe(NO3)2 Ionic or molecular?
Fe(NO3)2 is an ionic compound. Iron (Fe) is a metal and nitrate (NO3) is a polyatomic ion, so together they form an ionic bond in Fe(NO3)2.
What is the formula of mercurous nitrate?
Hg22+ + NO3- -----> Hg2(NO3)2
Trending Questions
What do you do in the lair of the beast on Neopets?
How old is karlie red?
What dose the troposphere occurs?
What type of stimulus opens gated channels?
Scottish mime artist who tought david bowie to mime?
What is the lowest temperature ever recorded in Madagascar?
Distance from Perth to monkey mia?
When was Charles Pasternak born?
Is there a high incidence of tornadoes in the Tennessee area?
What is Jesse's middle name?
What two animals make a mule?
Where can one purchase chef aprons?
A 18 sided 2D shape?
How can I get a fish eye camera on my iPhone?
Do owls sleep on branches?
Why does lilly smell?
Who was the french military leader was born in 1769 and died in 1821?
Does cutting hair make it thicker?
Which law would a court most likely use intermediate scrutiny to examine?
What does it mean when the starter in a 1989 Chevy Caprice is out and the car is leaking oil?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.