0
What else can I help you with?
Related Questions
The correct name for NO3?
NO3 is known as nitrate.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What is the product of NO3 and iron II?
the equation would look like: 2(NO3) + Fe --> Fe(NO3)2 the 2 in front of the NO3 is there to balance the equation.
What the name of Al(NO3)3?
Al(NO3)3 is aluminum nitrate.
Is Fe(NO3)2 Ionic or molecular?
Fe(NO3)2 is an ionic compound. Iron (Fe) is a metal and nitrate (NO3) is a polyatomic ion, so together they form an ionic bond in Fe(NO3)2.
What is the formula of mercurous nitrate?
Hg22+ + NO3- -----> Hg2(NO3)2
Trending Questions
What regulates the activities of other glands?
Why is the use of nuclear energy controversial?
How do you know what women want in bed?
What are some companies that offer the cheapest car insurance in Ireland?
What were the names of soldiers in the Battle of Antietam?
How long does a person take to make an initial judgment of another persons character and abilities?
Who made the sears model 53 30-06 model 27332010?
In the Russian revolution what were the purges?
What is the simplified radical form of 128?
As one muscle contracts the must relax.?
How many euros is 42 pounds?
What percentage people watch an activity before trying it themselves?
Why is owatonna nicknamed owl city?
How does sin alienate?
What was Bruce Springsteen's favorite drink?
What number equals 125 when divided by 200?
Which molecule is split apart in photosynthesis II?
A sentence with outcome in it?
What did he British government attempted to do with the proclamation of 1763?
Are hoopz and whiteboy dating?
Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.