0
What else can I help you with?
Related Questions
The correct name for NO3?
NO3 is known as nitrate.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is the product of NO3 and iron II?
the equation would look like: 2(NO3) + Fe --> Fe(NO3)2 the 2 in front of the NO3 is there to balance the equation.
What the name of Al(NO3)3?
Al(NO3)3 is aluminum nitrate.
Is Fe(NO3)2 Ionic or molecular?
Fe(NO3)2 is an ionic compound. Iron (Fe) is a metal and nitrate (NO3) is a polyatomic ion, so together they form an ionic bond in Fe(NO3)2.
What is the formula of mercurous nitrate?
Hg22+ + NO3- -----> Hg2(NO3)2
Trending Questions
Is the skyline locust tree seedless?
How do you repair a neutral safety switch on a 1995 Jeep Cherokee?
What did witches do in the 1500-1600?
What does the name danyielle mean?
Is home seller one word or 2 words?
What did King Christian X do to help the Jews?
What education and training is required to become an oceanographer?
What job did Giovanni verazzanos dad have?
What level does grimer evolve on on Pokemon FireRed?
What year would you graduate high school if you were born in 2010?
What is a multi-mixer?
What accomplishments did jean nicolet accomplish?
What is the production weight of a 1968 Chrysler Newport?
Why is the forked rush endangered?
What is the date of secondary school certificate exam 2005 result published?
What was the diameter of hurricane Opals eye?
Is juniper a flower?
Which types of organelles are most important to provide a cell with engergy?
Types of programes?
What year does Feb 1 fall on a Sunday?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.