0
What else can I help you with?
Related Questions
Do jellyfish have tentacles?
Yes. Tentacles are characteristic appendages of jellyfish.
What are jellyfish tentacles called?
Jellyfish do not have feet but they have tentacles which help them swim
Do Jellyfish need to have tentacles to be classified as Jellyfish?
no
How many tentacles are on a box jellyfish?
A box jellyfish has 15 tentacles on each of its sides and it has 3 sides.
What are marginal tentacles in jellyfish?
the tentacles on a jellyfish that surround the mouth..... resource.. http://www.ucmp.berkeley.edu/cnidaria/cnidariamm.html
Does a jellyfish have tentacles?
Yes, they do. Depending on what kind of jellyfish determines what they look like. Often time, the tentacles do the stinging.
What are the strings on a jellyfish?
tentacles
How do immortal jellyfish deal with predators?
Jellyfish have stinging tentacles.
Where Are the Stinging Cells of a Jellyfish Located?
The stinging cells in a jellyfish are located in it's tentacles.
How do jellyfish sting people?
by there tentacles
How much tentacles do jellyfish have?
ten
Where do jellyfish keep there poison?
In their tentacles!
Trending Questions
Can you legally grab the ball out of someone's hands in football?
Who is the girl in the offerup commercial?
Is maturbations in any way useful?
What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?
When is the best time of the year to buy a fan?
How deep is the frost line in Oregon?
How do you slow down a relationship that is moving too fast?
How can you get admission in Karachi grammar school?
What do you do if you find 30 maggots on your kitchen floor?
What is the function of lung upper lobe?
What is the minimum aperture setting that can be used for capturing sharp images in low light conditions?
Is lockdown escape from furnace a movie?
What is skeptical mean?
How do you say Santa Claus in Itallian?
What discovery helped decode hieroglyphics?
What type of electrical plugs are used in Japan?
What does like twigs mean?
Which frog organ does the human not have?
Do monkeys migrate or hibernate?
When did Teamo Supremo end?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.