0
CH3 stands for methyl group ,i.e. methyl group is formed when a hydrogen atom is removed from methane .
Wiki User
∙ 13y ago
Wiki User
∙ 9y agoCH3 actually does not have an official name since it is not a compound. However, it is referred to as a methyl group or radical.
Wiki User
∙ 12y agoI think its Propane =
H-H-H
H-C-C-C-H
H-H-H
Wiki User
∙ 12y agoCH3 is the chemical formula for a methyl group that may be attached to various molecules. Carbon likes to form 4 bonds so a CH3 will always look for something else to attach to.
Wiki User
∙ 12y agoNeither compounds, ions nor radicals are found in the periodic table, but the elements only.
Wiki User
∙ 12y agomethyphenyl
Add your answer:
Earn +20 pts
Is Ch3-O-CH3 capable of hydrogen bonding?
no it is not
HOW will you convert ethanoic acid into methenamine?
O O O CH3-C-OH+HCl--------> CH3-C-Cl+NH3 ---------> CH3-C-NH2 O CH3-C-NH2+Br2+KOH -----------> H3C-NH2+KBr+K2CO3+H2O
What is the name of CH3-O-CH3?
dimethyl ether
What is the product of 2AgClO3 and Na2CO3?
(ch3-c(=o)-ch3)
What is structure of methyl ether?
Dimethyl ether is CH3-O-CH3
What is the Structural formula of 3-chloro-2-methylpentane?
Ch3ch2ch(ch3)ch2ch=o
What is the formula of methyl ether?
Ch3 -o- ch3
Is Ch3-O-CH3 capable of hydrogen bonding?
no it is not
What is the structure of 2-pentanone?
CH3-CH(=O)-CH(CH3)-CH2-CH3
What is the common name of the compound CH3 CH3?
o-diethylbenzene
HOW will you convert ethanoic acid into methenamine?
O O O CH3-C-OH+HCl--------> CH3-C-Cl+NH3 ---------> CH3-C-NH2 O CH3-C-NH2+Br2+KOH -----------> H3C-NH2+KBr+K2CO3+H2O
What is structure of methyl ether?
Dimethyl ether is CH3-O-CH3
What is the product of 2AgClO3 and Na2CO3?
(ch3-c(=o)-ch3)
What is the name of CH3-O-CH3?
dimethyl ether
Can we write CH3-O-C2H5 as C2H5-O-CH3 for ethyl methyl ether?
Yes, these formulae are interchangeable.
Condense structural formula of methyl pentanoate?
Ch3-ch2-ch2-ch2-c(=o)-o-ch3
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
