0
What else can I help you with?
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
Is Ch3-O-CH3 capable of hydrogen bonding?
No, Ch3-O-CH3 (dimethyl ether) cannot form hydrogen bonds. Hydrogen bonding requires a hydrogen atom bonded to an electronegative atom such as oxygen, nitrogen, or fluorine. In dimethyl ether, both of the carbon atoms are bonded to oxygen, not hydrogen.
HOW will you convert ethanoic acid into methenamine?
Ethanoic acid can be converted into methenamine by reacting it with formaldehyde in the presence of aqueous ammonia. This reaction undergoes a condensation reaction to form methenamine as the final product.
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the formula of methyl ether?
Ch3 -o- ch3
What is the structure of 2-pentanone?
CH3-CH(=O)-CH(CH3)-CH2-CH3
What is the common name of the compound CH3 CH3?
o-diethylbenzene
What is the chemical formula of ethyl ethanoic?
The structural formula is CH3COOCH2CH3
Can we write CH3-O-C2H5 as C2H5-O-CH3 for ethyl methyl ether?
No, the chemical structure CH3-O-C2H5 should be written as CH3-O-C2H5 for ethyl methyl ether. The order of the groups is based on the IUPAC naming rules, where the groups are listed in alphabetical order.
How do you write the structures of 3-methyl-2-butanone?
H3c o ch3 ch3
What is the structual formula for ether?
R-O-R where , R = alkyl group For Example, CH3 - O -CH3 is di-methyl ether, C2H5 - O -C2H5 is di-ethyl ether, C2H5 - O - CH3 is ethyl methyl ether......etc.
What is the equation for hydrolysis of the acetamide solution in a acid?
CH3-C=O-NH2 +HCl----> CH3-C=O-OH+ NH4Cl
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
What is this C-C-C-O-C-C?
this is nothing actually is... CH3-CH2-CH2-O-CH2-CH3 ethyl methyl ether....
Condense structural formula of methyl pentanoate?
The structural formula of methyl pentanoate is CH3CH2CH2CH2COOCH3.
