0
side
What else can I help you with?
Related Questions
What does the math term lateral mean?
Lateral refers to the sides.
What does lateral mean mathematically?
Lateral means side, quadrilateral (4 sides)
What does the prefix lat mean?
side......as in lateral
What does lateral ischemia mean?
Lateral ischemia refers to reduced blood flow or oxygen supply to the lateral part of an organ or tissue. This can lead to tissue damage or dysfunction in the lateral area affected by the restricted blood flow.
What does lateral position mean?
beginner or basic level
What do lateral line system mean?
Lateral line system means an aquatic organs sense system found in fish
What does the medical abbreviation RLE mean?
right lateral extremity
What does the medical abbreviation LAT mean?
Lat means lateral.
What do red stakes mean?
Red stakes are a lateral water hazard.
What prefix combined with lateral mean pertaining to one side?
The prefix "uni-" combined with lateral means pertaining to one side.
What does continetal drift mean?
the lateral movement of continents resulting from the motin of crustal
What does dialog mean in lateral arts?
dialog is the things that you say, the words you speak.
Trending Questions
He was hanged for treason?
What is the real name of Little Richard?
Where is verbal bullying held?
When the wind speed is x meters per second the wind turbine generates twice as much power as it does when the wind speed is 10 ms Calculate the value of x Give your answer to 3 significant figures?
How many ways are there to spell sincere?
What is -4 multiplied by -10?
What does the name dayza mean?
What is the highest priority substituent in CH3CH2CH2-CH2CH(CH3)2-CC-CH2CH2Br- CH2Cl?
What medicine will make you tall?
What if your child's white cell count is at 27000?
What is good paper to use to roll weed up with besides rolling papers?
What is 21 over 56 in percentage?
If a typical radial engine has a bore of 5.5 inches and a stroke of 5.5 inches what is the area and where is the piston displacement?
How do you tighten belt on 1990 Isuzu trooper?
What provides most of the water for the water cycle?
What day was July 13 1943?
How much does it cost to get a general contractor license?
How can I make a fast dua for seeking guidance and blessings?
Does Pedro alvares cabral have siblings?
Can you eat when your about to have a ct scan of the head?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.