0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the formula for nickelIInitrate?
In my knowledge of seventh grade of elementary school it is: Ni(NO3)2
What is a compound composed of lithium and the nitrate polyatomic ion?
Li(N03) is the formula of lithium nitrate, Li+ ion and NO3- ion are combined in this salt (compound)
What are three nitrates that do not respond to brown ring test?
Ca(no3)2,ba(no3)2,pb(no3)2
How many single bonds in NO3?
(NO3)- has three single bonds.
What is No3-1?
You must mean....NO3(-) this is the polyatomic ion nitrate
Equation for lead nitrate and calcium iodide are combined?
Pb(NO3)2 + CaI2 -> PbI2 + Ca(NO3)2
What is NO3 and NO4 stand for in chemistry?
NO3 means one nitrogen atom combined with 3 oxygen atoms to produce the nitrate ion. NO4 is one nitrogen atom combined with 4 oxygen atoms.
What is the difference between lithium nitride and lithium nitrate?
Nitride means combined with nitrogen alone eg Li3N. Nitrate means combined with NO3 eg LiNO3
What is the formula for nickelIInitrate?
In my knowledge of seventh grade of elementary school it is: Ni(NO3)2
What is a compound composed of lithium and the nitrate polyatomic ion?
Li(N03) is the formula of lithium nitrate, Li+ ion and NO3- ion are combined in this salt (compound)
When aqueous solutions of silver I nitrate and ammonium phosphate are combined solid silver I phosphate and a solution of ammonium nitrate are formed The net ionic equation for this is?
3 Ag+ + 3 (NO3)- + 3 (NH4)+ + (PO4)3- = Ag3PO4(s) + 3 (NH4)+ + 3 (NO3)-
Is nitrate a metal or non metal?
Nitrate, NO3- ion, is not an element, so it is useless to classify as (non-)metal. When combined with metal ions it becomes a (soluble) salt.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
How many atoms in AL(NO3)3?
its Al + NO3 + NO3 + NO3. So one Al, three N and nine O. That makes 13 atoms.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
