0
Nickel (III) Bromide
Wiki User
∙ 15y ago
Add your answer:
Earn +20 pts
What is the formula for Ni positive 3 and Br negative 1?
NiBr3
What is the formula for copper II nitrate trihydrate?
Cu(NO3)2 ・3H20
How oxalic acid removes rust?
Rust is Fe2O3 ....it can not be removed by 1.HCl 2.H2So4 3.Edta..... but can remove by Oxalic Acid H2C2O4 Fe2O3(s) + 6 H2C2O4(aq) → 2 Fe(C2O4)3 3−(aq) + 3 H2O(l) + 6 H+(aq)
Iron rusts when it comes in contact with water because of?
Iron or Fe is relatively highly reactive metal, hence when reacts with any oxidising object (like water), it gets oxidized. The reaction goes as follows- 2Fe + 3H20--> Fe203 (rust) + 3H2 Hence, Iron rusts when it comes in contact with water due to its high oxidising nature, i.e., it easily gets oxidised to rust.
What is the coefficient number in a chemical formula?
A coefficient in a chemical formula tells you how many molecules there are. For example, 3Co2. The number 3 which comes before the C tells you that there are 3 molecules. The coefficient is the first number. This molecules consist of 3 C atoms (1 multiplied by the coefficient 3), and 6 O atoms( 2 multiplied by the coefficient 3) Another example: H= one hydrogen atom H2= one molecule made of 2 hydrogen atoms bonded together 3H20= three molecules consisting of two hydrogen atoms bonded to one oxygen atom
What is the formula for Ni positive 3 and Br negative 1?
NiBr3
What is the formula for copper nitrate trihydrate?
Cu(NO3)2 ・3H20
How long does it take to drive from Leuven to Charles de Gaulle airport?
About 3h20.
What is the formula for copper II nitrate trihydrate?
Cu(NO3)2 ・3H20
What will be the product of the reaction of ethanol and NaOH and iodine?
CH3I + COONa + 3NaI + 3H20
What is the reaction for anaerobic respiration?
c6H12O6 + 3hco3- + 3h+ >>> 6co2 + 3h20 + 3ch4
How do you say 3 20 in french?
3:20 --> 3h20 (or 18h20, if it's in the afternoon) --> trois heures vingt
What is produced when iron reacts with water?
Iron oxide is produced.The chemical reaction is given as 2Fe+3H20=Fe2O3+3H2
Which of the following combustion reactions is balanced correctly?
The correct answer is: C5H12 + 8O2 5CO2 + 6H2O.
When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?
Your formulas are not correct.
How far is it from Paris to Mont St Michel?
the distance from Paris to the Mont-Saint-Michel is 358 km by the A13 motorway. The driving time is 3H20.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
