0
What else can I help you with?
Balanced equation of HCH3COO NaOH?
The balanced equation for the reaction between acetic acid (HC2H3O2) and sodium hydroxide (NaOH) is: HC2H3O2 + NaOH → NaC2H3O2 + H2O
What is the balanced equation for the reaction of amidosulphuric acid and sodium hydroxide?
The balanced equation for the reaction between amidosulfuric acid (NH2SO3H) and sodium hydroxide (NaOH) is: NH2SO3H + NaOH → NaHSO3 + H2O
How do you write a balanced reaction for when HCl reacts with NaOH to form NaCl and H2O?
The balanced reaction for the reaction between HCl and NaOH is: HCl + NaOH -> NaCl + H2O This equation is already balanced as it shows the conservation of mass and charge.
What is the balanced equation for the reaction of salicyclic acid and sodium hydroxide?
The balanced equation for the reaction between salicylic acid and sodium hydroxide is: C7H6O3 + NaOH → C7H5NaO3 + H2O
What is the balanced chemical equation of NaOH and tartaric acid?
The balanced chemical equation for the reaction between NaOH (sodium hydroxide) and tartaric acid (C4H6O6) is: 2NaOH + H2C4H4O6 -> 2H2O + Na2C4H4O6
Balanced equation of HCH3COO NaOH?
The balanced equation for the reaction between acetic acid (HC2H3O2) and sodium hydroxide (NaOH) is: HC2H3O2 + NaOH → NaC2H3O2 + H2O
What is the balanced equation for the reaction of amidosulphuric acid and sodium hydroxide?
The balanced equation for the reaction between amidosulfuric acid (NH2SO3H) and sodium hydroxide (NaOH) is: NH2SO3H + NaOH → NaHSO3 + H2O
How do you write a balanced reaction for when HCl reacts with NaOH to form NaCl and H2O?
The balanced reaction for the reaction between HCl and NaOH is: HCl + NaOH -> NaCl + H2O This equation is already balanced as it shows the conservation of mass and charge.
What is the product and balanced equation of C8H5O4K NaOH?
The reaction between C8H5O4K and NaOH will produce potassium salicylate (C7H5KO3) and water. The balanced equation is: C8H5O4K + NaOH → C7H5KO3 + H2O.
What is the balanced equation for the reaction of salicyclic acid and sodium hydroxide?
The balanced equation for the reaction between salicylic acid and sodium hydroxide is: C7H6O3 + NaOH → C7H5NaO3 + H2O
What is the balanced chemical equation of NaOH and tartaric acid?
The balanced chemical equation for the reaction between NaOH (sodium hydroxide) and tartaric acid (C4H6O6) is: 2NaOH + H2C4H4O6 -> 2H2O + Na2C4H4O6
What is the balanced chemical equation for ammonium nitrate and sodium hydroxide?
The balanced chemical equation for the reaction between ammonium nitrate (NH4NO3) and sodium hydroxide (NaOH) is: NH4NO3 + NaOH -> NH3 + H2O + NaNO3
What is the balanced equation for hydrchloric and sodium hydroxide?
HCl + NaOH -> NaCl + H2O This is a balanced chemical equation representing the reaction between hydrochloric acid (HCl) and sodium hydroxide (NaOH) to form sodium chloride (NaCl) and water (H2O).
What is the balanced equation for ammonium sulfate and sodium hydroxide?
The balanced equation for the reaction between ammonium sulfate (NH4)2SO4 and sodium hydroxide NaOH is: (NH4)2SO4 + 2 NaOH -> 2 NH3 + Na2SO4 + 2 H2O
Complete the reaction NaOH plus HCL?
The reaction between NaOH and HCl produces NaCl (sodium chloride) and H2O (water). The balanced chemical equation is: NaOH + HCl → NaCl + H2O.
What is the balanced equation for silver nitrate and sodium hydroxide?
Assuming double displacement, AgNO3 + NaOH --> AgOH + NaNO3
Balanced reaction of ethyl acetate and NaoH?
NaOH+H3COOC2H5 --> CH3COONA+C2H5OHTo make the components more clear.(Na-OH)+(H3COO-C2H5) --> (CH3COO-NA)+(C2H5-OH)
