0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the general equation for water and sodium carbonate?
No chemical reaction between water and sodium carbonate, only solving of the sodium carbonate in water.
What is the balanced chemical equation of NaOH and tartaric acid?
water and the sodium salt
What is a balanced chemical equation for sodium chloride plus carbon dioxide plus water?
Seltzer Water
What is the balanced chemical equation when sodium bicarbonate breaks down into sodium oxide carbon dioxide water?
the balanced chemical equation when sodium bicarbonate breaks down into sodium oxide carbon dioxide water is represented as follows.2 NaHCO3(s) CO2(g) + H2O(g) + Na2CO3(s).
What is the chemical equation of this reaction Solid sodium chloride dissolves in water.?
Sodium chloride is dissociated in water: NaCl---------------------Na+ + Cl-
Sodium acetate and water chemical equation?
the equation for sodium acetate with water is NaC2H3O2+2(H2O)=Na+C2H3O2(solid).
What is the general equation for water and sodium carbonate?
No chemical reaction between water and sodium carbonate, only solving of the sodium carbonate in water.
What Is The Chemical Equation For sodium oxide combines with water to make sodium hydroxide?
Na2O + H2O -> 2NaOH
What is the Equation for sodium phosphate and water?
Na3PO4+H2O->NaOH+H3PO4 just balance it.
What is the balanced chemical equation of NaOH and tartaric acid?
water and the sodium salt
Why To balance a chemical equation can we change the formulae of either reactants or products?
if it is a redox reaction sometimes you can add water to help balance the equation
What is a balanced chemical equation for sodium chloride plus carbon dioxide plus water?
Seltzer Water
Balance equation of sodium chloride with water?
Sodium chloride doesn't react with water; the phenomenon is a dissociation:NaCl---------------→Na+ + Cl-
What is the balanced chemical equation when sodium bicarbonate breaks down into sodium oxide carbon dioxide water?
the balanced chemical equation when sodium bicarbonate breaks down into sodium oxide carbon dioxide water is represented as follows.2 NaHCO3(s) CO2(g) + H2O(g) + Na2CO3(s).
What is the chemical equation showing the reaction between sodium and water?
2Na + H2O -> 2NaOH+H2
What is the chemical reaction for sodium hydroxide and hydrogen phosphate react to form sodium phosphate and water?
The chemical equation is:3 NaOH + H3PO4 = Na3PO4 + 3 H2O
