0
Yes. Chlorofluorocarbons are greenhouse gases. They were largely responsible for damaging the ozone layer, but they have been checked since the Montreal Protocol (1987 - 1999), which has been ratified by 196 countries.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
What gases are harmful to the ozone?
CFC(Cholorofluorocarbons) gases which are pollutants are responsible for the depletion of ozone layer. CFC convert ozone to oxygen and make it useless for the absorption of UV radiation.
What is another name for extremophiles?
Another name for extremophiles is Archaea.
What is another name for nociceptors?
Another name for nociceptors are pain receptors.
What is another name for the cerebral cortex?
Another name for the cerebral cortex is the telencephalon.
What is another name for prokaryotic?
bacteria and Archea is another name for prokaryotes.
Chlorofluorocarbon (CFC) emissions are still increasing?
Chlorofluorocarbon (CFC) emissions are still increasing.
What is chemical name of cfc?
CFC is an abbreviation for the class of chemical compounds known as Chloro-Fluoro-Carbons.
What does the f stand for in CFC?
ChloroFluoroCarbon is the full form of CFC.
What compound was found to be destroying the ozone layer?
CFC's (chlorofluorocarbon's)
What does CFC smell like?
Chlorofluorocarbon smells like Freon
What is the organic compound which was widely used as refrigerant to be faced out?
chlorofluorocarbon (CFC)
How do you destroy chlorofluorocarbon?
We can destroy CFC's by not creating them at all. They deplete ozone.
How can you minimize the effects of chlorofluorocarbon?
CFC's can be minimized. HCFC's should be used.
What items are making the ozone layer disappear?
chlorofluorocarbon. CFC... Its in hairsprays, Lysol cans, and another example spray deodorant ....lots of it comes in a can.
Is Methyl Ethyl Ketone a CFC?
A chlorofluorocarbon, or CFC, contains chlorine, fluorine and carbon. MEK (CH3COCH2CH3) contains carbon, hydrogen and oxygen. It's not a CFC.
What are the specific air pollutants that cause ozone layer depletion?
chlorofluorocarbon or CFC .
Between 1970 and 1996 this pollutant saw increased emissions in the US?
Chlorofluorocarbon (CFC).
