0
CFC(Cholorofluorocarbons) gases which are pollutants are responsible for the depletion of ozone layer. CFC convert ozone to oxygen and make it useless for the absorption of UV radiation.
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
Why is ozone important to living organisms?
Ozone shields living organisms from harmful ultraviolet rays emitted by the sun. Without the ozone layer, plants could not survive. Ozone depletion causes increased risks of skin cancer and cataracts in humans.
Which layer of the skin is associated with protection from the ultraviolet light?
The O-zone layer protects us from UV rays emitted from the sun.
Whether the size of this ozone hole is changing and in what manner scientists think this would affect life on earth?
The ozone hole opens and closes at each pole, once each year. The record sized ozone hole was a couple of years ago (2006), and the hole every year since has been a bit smaller. No real reason to believe the actions of Man are the cause for the decrease in size, but maybe... Ozone protects DNA-bearing life from cancer and mutation. Ozone protects organisms with eyes from cataracts. Ozone protection increases crop yields, and increases arable land. Ozone does this by absorbing UV-B from our Sun, which otherwise breaks down DNA.
How many molecules does ozone have?
Ozone has three oxygen atoms. Ozone has two forms: O-O=O and O=O-O, and it oscillates between these forms.
What is an example of harmful?
many things cyanide, cyanide compounds, heavy metals, radioactive material, inert gases such as nitrogen causes asphixia, hydrogen sulphide, clorine, hydrogen chloride, phosphine, phosgene, bacteria or other living things may take up resources. Heaps more
How does the volcano affect the ozone layer?
Volcanic eruptions release harmful gases. These gases deplete the ozone.
Is ozone harmful or helpless?
the ozone is hrmful.... it has many hurtful and dangerous gases
What harmful gases do plants absorb?
Ozone and heavy metals are harmful to plants.
What are the different harmful gasses that depletes the ozone layer?
The CFC's that is chlorofluorocarbons are the ones that destroy the ozone most. It attacks the ozone molecule present in the stratosphere and destroys it.
What gases 1carbon dioxide 2 nitrogen 3 ozone protects us from harmful sun rays?
ozone
What gases do the ozone protect us from?
The ozone mainly protects us from the Ultra Violent rays of the Sun. May be some acidic harmful gases too.
Area of protective gases that blocks harmful solar rays?
This area is ozone layer. It contains a pool of ozone molecules.
How is the ozone layer of the atmosphere getting destroyed?
harmful gases concentrating the suns ray
What is damaging ozone?
Harmful gases released as harmful fumes into the air.(Mainly caused by man.)See "What is causing the depletion of the ozone layer?" in the "Related questions" section below.
Which gases absorb ultraviolent radiation?
The gas which absorb ultraviolet radiation is ozone. It absorbs the harmful Uv radiations from the sun.
What do ozone do?
Actually ozone layer is located 15km above the earth it absorbs 99%of sun rise and makes the climate mild. It has many gases which can guard the earth from many harmful gases. We are polluting the earth and almost destroying the ozone layer. Ozone is very helpful.
Will the japan nuclear meltdown damage the ozone layer?
Yes it will. It released various harmful gases.
