0
What is the complete ionic equation for NaOH plus HC equals H2O plus NaCl?
Wiki User
∙ 8y ago
C6H8O6+NaHCO3<->CO2(g)+H2O(liq)+C6H7O6-+Na+
Wiki User
∙ 9y ago
Wiki User
∙ 14y agoC8H802 is not possible. C8H8O2 is possible, but it could be several different compounds; it's hard to know what the equation is without knowing what the starting material is for certain.
Wiki User
∙ 14y agoI have no clue but I do know that your wife is going out with 26 other men
Anonymous
(Na+) + (OH-) + (H+) + (CI-) = (H+) + (OH-) + (Na+) + (CI-)
Add your answer:
Earn +20 pts
What is complete ionic equation for hcl-naoh?
It will be a neutralization reaction and the products will be NaCl and H2O
What is the ionic equation of cacl2 plus na2s equals cas plus nacl?
cacl2 plus na2s equals cas plus
What are the examples of ionic equation?
Na+Cl2=NaCl
What is the complete ionic equation for NaOH(aq) plus HCL(aq) H2O(I) plus NaCL(aq)?
The chemical equation is:Na + OH- + H+ + Cl- = Na+ + Cl- + H2O(l)
Complete net ionic equation agno3 plus NaCl?
CuCl2(aq) + 2AgNO3(aq) = Cu(NO3)2(aq) + 2AgCl(s)
What is the molecular equation complete ionic equation and the net ionic equation for NaCl Na2CO3?
These two compounds doesn't react.
What is complete ionic equation for hcl-naoh?
It will be a neutralization reaction and the products will be NaCl and H2O
What is the ionic equation of cacl2 plus na2s equals cas plus nacl?
cacl2 plus na2s equals cas plus
What are the examples of ionic equation?
Na+Cl2=NaCl
What is the ionic equation of sodium chloride?
NaCl-------------> Na+ + Cl-
What is the complete ionic equation for NaOH(aq) plus HCL(aq) H2O(I) plus NaCL(aq)?
The chemical equation is:Na + OH- + H+ + Cl- = Na+ + Cl- + H2O(l)
Complete net ionic equation agno3 plus NaCl?
CuCl2(aq) + 2AgNO3(aq) = Cu(NO3)2(aq) + 2AgCl(s)
What is the complete ionic equation for NaOH(aq) plus HCl(aq) H2O(l) plus NaCl(aq)?
The chemical equation is:Na + OH- + H+ + Cl- = Na+ + Cl- + H2O(l)
Is NaCl H2O a complete and balanced chemical equation?
No, NaCl H2O is not a chemical equation. An equation must have an equal sign. And even if you put an equal sign into those terms, it is not true that NaCl = H2O, so that would be a false equation, not a complete and balanced equation. You are not even close to having that.
What is the complete ionic equation for NaOH(aq) plus HCl(aq) H2O() plus NaCl(aq)?
The chemical equation is:Na + OH- + H+ + Cl- = Na+ + Cl- + H2O(l)
What is the complete ionic equation for naohaq hciaqh2oi naciaq?
NaOH(aq) + HCl(aq) ---> H2O(l) + NaCl(aq) Na+ + OH- + H+ + Cl- ---> H2O + Na+ + Cl-
What is a balanced ionic equation for sodium chloride in water?
NaCl (s) --> Na+(aq) + Cl-(aq)
