answersLogoWhite

0

C6H8O6+NaHCO3<->CO2(g)+H2O(liq)+C6H7O6-+Na+

User Avatar

Wiki User

11y ago

What else can I help you with?

Related Questions

What is the molecular equation complete ionic equation and the net ionic equation for NaCl Na2CO3?

These two compounds doesn't react.


Complete net ionic equation agno3 plus NaCl?

CuCl2(aq) + 2AgNO3(aq) = Cu(NO3)2(aq) + 2AgCl(s)


What is the ionic equation of sodium chloride?

NaCl-------------&gt; Na+ + Cl-


What is total ionic for NaCl plus AgNO3?

The total ionic equation for NaCl + AgNO3 is: Na⁺ + Cl⁻ + Ag⁺ + NO₃⁻ → AgCl + Na⁺ + NO₃⁻


What are the examples of ionic equation?

An example of an ionic equation is: NaCl(s) -&gt; Na+(aq) + Cl-(aq) This equation shows the dissociation of solid sodium chloride into its ions sodium and chloride in an aqueous solution.


What is the ionic equation of cacl2 plus na2s equals cas plus nacl?

The balanced molecular equation is CaCl2 + Na2S -&gt; CaS + 2NaCl. To write the ionic equation, we need to break down the reactants and products into their respective ions. This results in the ionic equation: Ca2+ + 2Cl- + 2Na+ + S2- -&gt; CaS + 2Na+ + 2Cl-. Cross out spectator ions that appear on both sides of the equation to obtain the net ionic equation: Ca2+ + S2- -&gt; CaS.


What hppen when sodium hydroxide react with hydrochloric acid ionic equation?

The products are sodium chloride, which remains dissolved, and water. The complete ionic equation is Na+ + OH- + H+ + Cl- --&gt; Na+ + Cl- + H2O The net ionic equation is: H+ + OH- --&gt; H2O


What is the complete ionic equation fo NaOH(aq) HCl(aq) - H2O(l) NaCl(aq)?

The complete ionic equation for this reaction is: Na⁺(aq) + OH⁻(aq) + H⁺(aq) + Cl⁻(aq) → H₂O(l) + Na⁺(aq) + Cl⁻(aq) This equation shows all the ions present in the solution before and after the reaction occurs.


What is a balanced ionic equation for sodium chloride in water?

The balanced ionic equation for sodium chloride (NaCl) in water (H2O) is: NaCl (s) → Na+ (aq) + Cl- (aq) This equation shows the dissociation of sodium chloride into its ions sodium (Na+) and chloride (Cl-) in water.


What is the complete ionic equation for NaOH(aq) plus HCl(aq) H2O() plus NaCl(aq)?

The chemical equation is:Na + OH- + H+ + Cl- = Na+ + Cl- + H2O(l)


What is the complete ionic equation for NaOH(aq) plus HCl(aq) H2O(l) plus NaCl(aq)?

The chemical equation is:Na + OH- + H+ + Cl- = Na+ + Cl- + H2O(l)


What is the ionic equation for chlorine and sodium hydroxide?

The ionic equation for the reaction between chlorine and sodium hydroxide is: Cl2 + 2NaOH → NaCl + NaClO + H2O This reaction produces sodium hypochlorite (NaClO) and sodium chloride (NaCl) along with water (H2O).