C6H8O6+NaHCO3<->CO2(g)+H2O(liq)+C6H7O6-+Na+
CuCl2(aq) + 2AgNO3(aq) = Cu(NO3)2(aq) + 2AgCl(s)
An example of an ionic equation is: NaCl(s) -> Na+(aq) + Cl-(aq) This equation shows the dissociation of solid sodium chloride into its ions sodium and chloride in an aqueous solution.
The total ionic equation for NaCl + AgNO3 is: Na⁺ + Cl⁻ + Ag⁺ + NO₃⁻ → AgCl + Na⁺ + NO₃⁻
The balanced molecular equation is CaCl2 + Na2S -> CaS + 2NaCl. To write the ionic equation, we need to break down the reactants and products into their respective ions. This results in the ionic equation: Ca2+ + 2Cl- + 2Na+ + S2- -> CaS + 2Na+ + 2Cl-. Cross out spectator ions that appear on both sides of the equation to obtain the net ionic equation: Ca2+ + S2- -> CaS.
The products are sodium chloride, which remains dissolved, and water. The complete ionic equation is Na+ + OH- + H+ + Cl- --> Na+ + Cl- + H2O The net ionic equation is: H+ + OH- --> H2O
These two compounds doesn't react.
CuCl2(aq) + 2AgNO3(aq) = Cu(NO3)2(aq) + 2AgCl(s)
NaCl-------------> Na+ + Cl-
An example of an ionic equation is: NaCl(s) -> Na+(aq) + Cl-(aq) This equation shows the dissociation of solid sodium chloride into its ions sodium and chloride in an aqueous solution.
The total ionic equation for NaCl + AgNO3 is: Na⁺ + Cl⁻ + Ag⁺ + NO₃⁻ → AgCl + Na⁺ + NO₃⁻
The balanced molecular equation is CaCl2 + Na2S -> CaS + 2NaCl. To write the ionic equation, we need to break down the reactants and products into their respective ions. This results in the ionic equation: Ca2+ + 2Cl- + 2Na+ + S2- -> CaS + 2Na+ + 2Cl-. Cross out spectator ions that appear on both sides of the equation to obtain the net ionic equation: Ca2+ + S2- -> CaS.
The products are sodium chloride, which remains dissolved, and water. The complete ionic equation is Na+ + OH- + H+ + Cl- --> Na+ + Cl- + H2O The net ionic equation is: H+ + OH- --> H2O
The complete ionic equation for this reaction is: Na⁺(aq) + OH⁻(aq) + H⁺(aq) + Cl⁻(aq) → H₂O(l) + Na⁺(aq) + Cl⁻(aq) This equation shows all the ions present in the solution before and after the reaction occurs.
The chemical equation is:Na + OH- + H+ + Cl- = Na+ + Cl- + H2O(l)
The balanced ionic equation for sodium chloride (NaCl) in water (H2O) is: NaCl (s) → Na+ (aq) + Cl- (aq) This equation shows the dissociation of sodium chloride into its ions sodium (Na+) and chloride (Cl-) in water.
The chemical equation is:Na + OH- + H+ + Cl- = Na+ + Cl- + H2O(l)
The ionic equation for the reaction between chlorine and sodium hydroxide is: Cl2 + 2NaOH → NaCl + NaClO + H2O This reaction produces sodium hypochlorite (NaClO) and sodium chloride (NaCl) along with water (H2O).