0
Well, it's organic. Past that it's difficult to say with certainty. It could be a cyclic diether or diol, it could be an ester, it could be an alkene diether or diol ... the molecular formula alone doesn't provide enough information to be sure.
Wiki User
∙ 9y ago
Wiki User
∙ 9y agoWhen it is linear and saturated it might be CH3(CH2)18COOH standing for arachidic acid, eicosanoic acid.
CH3(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-C(OH)(=O).
Wiki User
∙ 13y agoretinol
Add your answer:
Earn +20 pts
What kind of molecule is an enzyme-?
The type of molecule that is an enzyme is a protein molecule.
What type of organic molecule usually functions as a carrier molecule?
its a carbohydrate
What type of transport is used to move a molecule from a region of low concentration yo a region of high concentration?
It depends what type of molecule it is; if it is a water molecule then it moves by Osmosis if it is a gas molecule for example Oxygen then it will move by diffusion.
What is the heat which travel molecule to molecule?
if you mean the transfer rate of heat ?; the heat transfer rate depends on the atom or molecule type .
What type of molecule is cis- 2-pentene?
Type your answer here... Alkene
What type of atom or molecule is lamppost?
What type of atom or molecule is in lamppost
What is composed on only one type of molecule?
What is composed of only one type of molecule
What is composed of only one type of molecule?
What is composed of only one type of molecule
Hemoglobin is what type of molecule?
A protein Molecule
What type of molecule is aquaporin?
it is a water channel, a protein molecule
What kind of molecule is an enzyme-?
The type of molecule that is an enzyme is a protein molecule.
Similarity of sulfur molecule and sulfur dioxide molecule?
The similarity of sulfur molecule and the sulfur dioxide molecule is the type of bond.
Carbon-12 represents what type of molecule?
It's not a molecule, it is an element
What type of organic molecule usually functions as a carrier molecule?
its a carbohydrate
Which piece of information do you need to determine whether a molecule is an alkene or an alkane?
the type of C-C bonds in the molecule-apex
What type of molecule is thiamin?
whatever molecule your science says it is. O3O :3
Hoy many atoms in a molecule?
Depending on the type of molecule: from 2 to thousands.
