0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the name of H3C H3C O OH?
2-butylhexanoic acid
Draw a molecule that has a three carbon skeleton and a hydroxyl group on the middle carbon?
H3C CH3 \ / CH | OH 2-propanol
HOW will you convert ethanoic acid into methenamine?
O O O CH3-C-OH+HCl--------> CH3-C-Cl+NH3 ---------> CH3-C-NH2 O CH3-C-NH2+Br2+KOH -----------> H3C-NH2+KBr+K2CO3+H2O
What is the common name of the following compound H3C H3C O OH?
2-propylpentanoic acid
What compound is this H3C-H3C-Cl-H-O?
H3C is a part of the larger compound H3C-CH2-O-CH3, which is ethyl methyl ether, also known as methoxyethane.
What makes THC?
Ch3,Oh,h3c,h2c,c5hh
What is the correct structure of 3-3-dimethylhexane?
H3c h3c ch3 ch3
What is the name of H3C H3C O OH?
2-butylhexanoic acid
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the structure of ethyl alcohol?
Ethyl alcohol, which is the old name for ethanol, is H3C-CH2OH
Draw a molecule that has a three carbon skeleton and a hydroxyl group on the middle carbon?
H3C CH3 \ / CH | OH 2-propanol
What is Structural formula for 2-methylpentane?
because it says anol that shows that it is an alchohol..... so start of with the word....pent...which means there are 5 carbons... the second carbon has CH3 over top.... and than the 1st carbon has an alch....OH group attached to it CH3 H H I I I HO-C - C - C - C - H I I I I H H H H because it says anol that shows that it is an alchohol..... so start of with the word....pent...which means there are 5 carbons... the second carbon has CH3 over top.... and than the 1st carbon has an alch....OH group attached to it HO-C-CHCH3-CH2-CH3
How do you write the structures of 3-methyl-2-butanone?
H3c o ch3 ch3
HOW will you convert ethanoic acid into methenamine?
O O O CH3-C-OH+HCl--------> CH3-C-Cl+NH3 ---------> CH3-C-NH2 O CH3-C-NH2+Br2+KOH -----------> H3C-NH2+KBr+K2CO3+H2O
What is the common name of the following compound H3C H3C O OH?
2-propylpentanoic acid
Is H3C--CH3 a functionalized hydrocarbon or hydrocarbon?
hydrocarbon
What compound is this H3C-H3C-Cl-H-O?
H3C is a part of the larger compound H3C-CH2-O-CH3, which is ethyl methyl ether, also known as methoxyethane.
