0
What else can I help you with?
Draw a molecule that has a three carbon skeleton and a hydroxyl group on the middle carbon?
H3C CH3 \ / CH | OH 2-propanol
What is the name of H3C H3C O OH?
2-butylhexanoic acid
What is the common name of the following compound H3C H3C O OH?
2-propylpentanoic acid
Is H3C-CH2OH a hydrocarbon or functionalized hydrocarbon?
first you need to know that what is a hydrocarbon .A hydrocarbon is a covalent compound in which only carbon and hydrogen is present . Now you can see that in CH3-CH2OH a functional group OH i.e. alcohol. so you got your answer that H3C-CH2OH is a functionalized hydrocarbon.
Is H3C-C-CH2-CH3 A hydrocarbon or a functionalized hydrocarbon?
H3C-C-CH2-CH3 is a hydrocarbon as it consists only of carbon and hydrogen atoms bonded together in a chain without any functional groups attached.
What makes THC?
Ch3,Oh,h3c,h2c,c5hh
What is the correct structure of 3-3-dimethylhexane?
H3c h3c ch3 ch3
Draw a molecule that has a three carbon skeleton and a hydroxyl group on the middle carbon?
H3C CH3 \ / CH | OH 2-propanol
What is the name of H3C H3C O OH?
2-butylhexanoic acid
Is H3C--CH3 a functionalized hydrocarbon or hydrocarbon?
hydrocarbon
How do you write the structures of 3-methyl-2-butanone?
H3c o ch3 ch3
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the common name of the following compound H3C H3C O OH?
2-propylpentanoic acid
What is Structural formula for 2-methylpentane?
because it says anol that shows that it is an alchohol..... so start of with the word....pent...which means there are 5 carbons... the second carbon has CH3 over top.... and than the 1st carbon has an alch....OH group attached to it CH3 H H I I I HO-C - C - C - C - H I I I I H H H H because it says anol that shows that it is an alchohol..... so start of with the word....pent...which means there are 5 carbons... the second carbon has CH3 over top.... and than the 1st carbon has an alch....OH group attached to it HO-C-CHCH3-CH2-CH3
What is h3c-c-ch2-ch3?
No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.
What is cl compound?
H3C is a part of the larger compound H3C-CH2-O-CH3, which is ethyl methyl ether, also known as methoxyethane.
What class of oxygen-containing molecules does h3c o o ch3 belong to?
esters
