answersLogoWhite

0

The compound you provided is 2-propanol.

User Avatar

AnswerBot

1y ago

What else can I help you with?

Related Questions

What makes THC?

Ch3,Oh,h3c,h2c,c5hh


What is the correct structure of 3-3-dimethylhexane?

H3c h3c ch3 ch3


Draw a molecule that has a three carbon skeleton and a hydroxyl group on the middle carbon?

H3C CH3 \ / CH | OH 2-propanol


What is the name of H3C H3C O OH?

2-butylhexanoic acid


Is H3C--CH3 a functionalized hydrocarbon or hydrocarbon?

hydrocarbon


How do you write the structures of 3-methyl-2-butanone?

H3c o ch3 ch3


What is Structural formula for 2-methylpentane?

because it says anol that shows that it is an alchohol..... so start of with the word....pent...which means there are 5 carbons... the second carbon has CH3 over top.... and than the 1st carbon has an alch....OH group attached to it CH3 H H I I I HO-C - C - C - C - H I I I I H H H H because it says anol that shows that it is an alchohol..... so start of with the word....pent...which means there are 5 carbons... the second carbon has CH3 over top.... and than the 1st carbon has an alch....OH group attached to it HO-C-CHCH3-CH2-CH3


What is the correct structure of 3-ethyl-3-methylhexane?

The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3


What is the common name of the following compound H3C H3C O OH?

2-propylpentanoic acid


What is h3c-c-ch2-ch3?

No such compound because the 2nd C from the left has only 2 bonds, and it needs to have 4 bonds. If you mean H3C --CH2--CH2--CH3, then this compound is n-butane.


What is cl compound?

H3C is a part of the larger compound H3C-CH2-O-CH3, which is ethyl methyl ether, also known as methoxyethane.


Is H3C-CH2OH a hydrocarbon or functionalized hydrocarbon?

first you need to know that what is a hydrocarbon .A hydrocarbon is a covalent compound in which only carbon and hydrogen is present . Now you can see that in CH3-CH2OH a functional group OH i.e. alcohol. so you got your answer that H3C-CH2OH is a functionalized hydrocarbon.