Cyclopentyl ethyl ester
Butane
In organic compounds, carbon forms four bonds for all practical purposes. There is a compound called methylene, CH2, but it is extremely reactive. The compound CCl2 can also be formed from the right precursors, and although it is a lot more stable than methylene, it is still very reactive. There are other examples where carbon does not have four bonds as in CH5+, CH3., and CH3+, but they are all extremely reactive meaning they have a very short lifetime.
The hypothetical compund about which you are inquiring does not exist because the second carbon from the left would require five bonds. Even the hypothetical compound where the second carbon were CH2 instead of CH3 also would not exist because in that case the middle carbon would only have three bonds, and if that were corrected by placing a double bond between the middle carbon and the carbon to its right, then that carbon would five bonds.
I can only guess that you meant to ask the name of the real compound
H3C-CH2-CH2-CH2-CH3. The name of that compound is pentane.
CH3CH2CH2CH2CH3 or C5H12 is an alkane; it is pentane.
Yes.
Propane
butane
propyl
Butane
Cyclopentyl ethyl ester
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
propyl-methyl ether
CH3-CH2-CH2-CH=CH2 will be names as 1-pentene or pent-1-ene
Butane
CH3-CH2-CH3 is a gas Propane.
Butane
1 - bromopropane is the IUPAC name for CH3-CH2-CH2-CH2-Br.
Cyclopentyl ethyl ester
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
propyl-methyl ether
CH3-CH2-CH2-CH=CH2 will be names as 1-pentene or pent-1-ene
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
Propane
Propane
It is 1 fluoropentane.