0
What else can I help you with?
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
Iupac name of ch3 - ch2 - O - ch2 - ch3?
Ethoxyethane Ethyl = 2 carbons ethane + oxygen + ethane = ethoxyethane
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the IUPAC name of ohcch2ch2coch2cooh?
that is methyl propyl ether. aka methoxy propane. not methoxy propyl ether. methyl propyl ether has 1 oxygen. methoxy propyl ether has 2 oxygens.
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
Iupac name of ch3 - ch2 - O - ch2 - ch3?
Ethoxyethane Ethyl = 2 carbons ethane + oxygen + ethane = ethoxyethane
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the IUPAC name of ohcch2ch2coch2cooh?
that is methyl propyl ether. aka methoxy propane. not methoxy propyl ether. methyl propyl ether has 1 oxygen. methoxy propyl ether has 2 oxygens.
What is the iupac name of CH3CH2COOH?
iupac name is butanedioic acid (according to wikipedia)but usually is called succinic acid
What is the name for ch3-ch2-ch2-ch2-o-c6h5?
It is 1-butoxy benzene
What is the name for ch3---o---c6h5 ch3---ch2---ch2---o---ch2---ch3?
Old names are: Methyl Phenyl Ether and Propyl Ethyl etherOfficial names are: Methoxybenzene and ethoxy-1-propane
What is the chemical formula of ethyl ethanoic?
The structural formula is CH3COOCH2CH3
What is this C-C-C-O-C-C?
this is nothing actually is... CH3-CH2-CH2-O-CH2-CH3 ethyl methyl ether....
Condense structural formula of methyl pentanoate?
The structural formula of methyl pentanoate is CH3CH2CH2CH2COOCH3.
What is the structure of 2-pentanone?
CH3-CH(=O)-CH(CH3)-CH2-CH3
