0
What else can I help you with?
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
What is the condensed formula for ethyl propanoate?
C5H10O2 Structurally CH3CH2C(=O)-O-CH2CH3 Name Ethyl propanoate (per IUPAC nomenclature).
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the iupac name for ch3 ch2 ch2 o ch3?
propyl-methyl ether
What is the IUPAC name for CH2 equals CH-O-CH3?
The IUPAC name for CH2=CH-O-CH3 is ethenyl methoxymethane.
What is the condensed formula for ethyl propanoate?
C5H10O2 Structurally CH3CH2C(=O)-O-CH2CH3 Name Ethyl propanoate (per IUPAC nomenclature).
What is the compound name of O-CH2-CH3?
The compound name of O-CH2-CH3 is ethyl methoxide.
What is the name of CH3-ch2 -ch2-o-ch2-ch2-ch3?
Cyclopentyl ethyl ester
What is the IUPAC name of ohcch2ch2coch2cooh?
that is methyl propyl ether. aka methoxy propane. not methoxy propyl ether. methyl propyl ether has 1 oxygen. methoxy propyl ether has 2 oxygens.
What is the iupac name of CH3CH2COOH?
iupac name is butanedioic acid (according to wikipedia)but usually is called succinic acid
What organic compounds class does octanal belong to?
OctanAl is an aldehyde. Structural formula is CH3-CH2-CH2-CH2-CH2-CH2-CH2-C(=O)-H Do NOT confuse with OctanOL, which is an alcohol Structural formula is CH3-CH2-CH2-CH2-CH2-CH2-CH2-CH2-O-H NB There is only ONE letter difference in the name ; 'O' for 'A'. NNB Formula writing of aldehydes is R-CHO , and the formula writing of alcohols is R-CH2OH. This is the international IUPAC Standard for indicating these functional groups.
What is the name for ch3-ch2-ch2-ch2-o-c6h5?
It is 1-butoxy benzene
What is the name for ch3---o---c6h5 ch3---ch2---ch2---o---ch2---ch3?
Old names are: Methyl Phenyl Ether and Propyl Ethyl etherOfficial names are: Methoxybenzene and ethoxy-1-propane
What is the chemical formula of ethyl ethanoic?
The structural formula is CH3COOCH2CH3
What is this C-C-C-O-C-C?
this is nothing actually is... CH3-CH2-CH2-O-CH2-CH3 ethyl methyl ether....
