0
H2C=C(CH3)COOCH3
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
Structural formula for p-xylene?
The structural formula for p-xylene is C8H10. It consists of a benzene ring with a methyl group attached to the fourth carbon atom.
Condense structural formula of methyl pentanoate?
Ch3-ch2-ch2-ch2-c(=o)-o-ch3
What is the formula for butanone?
Butanone is the IUPAC name for methyl ethyl ketone (MEK). Empirical: C4H8O. Structural: CH3COCH2CH3.
What is made out of acrylic?
Acrylic is made into fake fingernails, shower doors, skylights, tail lights on vehicles and aircraft windows.
What is the formation formula of methyl benzene?
The formula is C7H8.
What is the Structural formula for 3-methyl-1-butene?
structural formula of c5h10
What is a plexiglas monomer?
Methyl Methacrylate
How do you separate mono-methyl hydroquinone ether from methyl methacrylate?
Monomeric methyl methacrylate can be freed of hydroquinone inhibitor by shaking with 5 N sodium hydroxide and desiccating with 8-mesh calcium chloride.
Structural formula of 3-chloro 2-methyl 1-butanol?
A structural formula diagram of 3-chloro-2-methyl-1-butanol would include HO with a line drawn from it. Attached to the line would be offshoots which represented the methyl and butanol.
What is the condensed structural formula for methyl acetate?
H3c-c(=o)(-och3)
Condensed structural formula of methyl propyl ether?
Ch3-o-c3h7
What is the structural formula for methyl group?
Formula: HCH2OH = CH4O
What what is the structural formula for CH3CH2COCH3?
That IS the structural formula. The compound is called either 2-butanone or methyl ethyl ketone.
What is the other name for perspex?
The plastic in perspex (the common US name is plexiglas) is poly(methyl methacrylate).
Is methyl methacrylate used in nail polish?
According to Sheldon Cooper - yes, and he can smell it.
Structural formula for p-xylene?
The structural formula for p-xylene is C8H10. It consists of a benzene ring with a methyl group attached to the fourth carbon atom.
What is the difference between acrylic and polymethyl methacrylate?
Poly(methyl methacrylate) or PMMA is commonly reffered to as acrylic or acrylic glass. So generally, they're the same thing.
