0
Please see the related link for an image
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What is the Molecular mass of 2-pentanone?
86.13
2-pentanone to 2-pentanol distinguish?
2-pentanone is CH3(C=0)CH2CH2CH3 and is a ketone with a distinct smell. 2-pentanol is CH3CH(OH)CH2CH2CH3 and is an alcohol with completely different properties.
Is 2-pentanone polar or non-polar?
2-naphthol has a polar molecule.
What is the condensed structural formula for 4-bromo-2-pentanone?
The formula is C5H9BrO.
What chemical test could be performed to differentiate between pentanal and 3-pentanone?
Since propanal is an aldehyde and 2-propanone is a ketone you can use the Jones reagent which will oxidize the aldehyde to a carboxylic acid. This will cause a green salt to precipiate. The 2-propanone should have no reaction and remain unchanged.
What is the structure of pentanone?
Please see the related link for an image
What is the structure of 2-pentanone?
CH3-CH(=O)-CH(CH3)-CH2-CH3
What is the structural formula of 3 pentanone?
Ch3ch2coch2ch3
Are 2-pentanone and 3-pentanone are isomers?
They are metamers but not position isomers
What chemicals contain 2-pentanone?
2-pentanone IS a chemical. One place it's found is in tobacco.
What are the chemical tests to distinguish between 2 pentanone and 3 pentanone?
Do an iodoform test. Use an aqueous solution of iodine and potassium iodide added to basic solutions of 2-pentanone and 3-pentanone.The iodoform reaction is a classical test for methyl ketones. A light-yellow precipitate of iodoform forms immediately with the methyl ketone of 2-pentanone.To confirm:1H NMR3-pentanone will show only 2 signals: a triplet at ~1.33 and a quartet at ~2.352-pentanone will show 4 signals: a triplet at ~0.90, a sextet at ~1.55, a singlet at ~2.05 and a triplet at ~2.40
What is the Molecular mass of 2-pentanone?
86.13
What is the commonname of pentanone?
mthyl propyl keton
2-pentanone to 2-pentanol distinguish?
2-pentanone is CH3(C=0)CH2CH2CH3 and is a ketone with a distinct smell. 2-pentanol is CH3CH(OH)CH2CH2CH3 and is an alcohol with completely different properties.
What is the condensed structural formula for 4-bromo-2-pentanone?
The formula is C5H9BrO.
Is 2-pentanone polar or non-polar?
2-naphthol has a polar molecule.
What is the boiling point of 2 pentanone?
The boiling point of benzene is 176 oF (80.1 oC).
