4-methyl-4-nonene
CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3
The (CH3) is a methyl group stemming from the CH just before it (#4).
- single bond
= double bond.
What sentence structure is this? - It is a simple structure for an interrogative sentence.
i feel like a uchia
structure of L asparginase structure of L asparginase
Ice structure and Diamond structure.(two more examples of a non-silicate structure: Pyrite structure and natural gas hydrates).
what is clotomic structure
A structure that is a member of another structure is a structure within a structure.
There are four types of protein structure. These include primary structure, secondary structure, tertiary structure, and quaternary structure. Primary structure is the amino acid sequence. Secondary structure is the shape of the molecule. Tertiary structure is the interaction between groups. Quaternary structure is the interactions between protein subunits.
the difference between an organisational structure and a matrix structure is that a matrix structure is a combined structure whereas an organisational structure is in a vertical order and has different levels.
What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.
surface structure is a structure at the surface
What sentence structure is this? - It is a simple structure for an interrogative sentence.
cells structure you
Celia does not have a structure. It is the only cell part that does not have a structure.
hotel structure is a structure composes of many organizations
capital structure decisions are structure with decisions
i feel like a uchia
reliance fresh structure reliance fresh structure reliance fresh structure