answersLogoWhite

0


Best Answer

4-methyl-4-nonene

CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3

The (CH3) is a methyl group stemming from the CH just before it (#4).

- single bond

= double bond.

User Avatar

Wiki User

13y ago
This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: What is the structure of 4-methyl-4-nonene?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

What is meant by a structure within a structure?

A structure that is a member of another structure is a structure within a structure.


Differentiate the four types of protein structure?

There are four types of protein structure. These include primary structure, secondary structure, tertiary structure, and quaternary structure. Primary structure is the amino acid sequence. Secondary structure is the shape of the molecule. Tertiary structure is the interaction between groups. Quaternary structure is the interactions between protein subunits.


What is the difference between a matrix structure and a organisational structure?

the difference between an organisational structure and a matrix structure is that a matrix structure is a combined structure whereas an organisational structure is in a vertical order and has different levels.


Can you give a hard science question?

What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.


What is surface structure in engineering?

surface structure is a structure at the surface


What is this structure?

What sentence structure is this? - It is a simple structure for an interrogative sentence.


What does structure you?

cells structure you


What is the structure of to celia?

Celia does not have a structure. It is the only cell part that does not have a structure.


What is a hotel structure?

hotel structure is a structure composes of many organizations


What is capital structure decisions?

capital structure decisions are structure with decisions


What type of structure are ice skates ( soild structure frame structure or shell structure.)?

i feel like a uchia


Organisational structure of reliance fresh?

reliance fresh structure reliance fresh structure reliance fresh structure