The cation of potassium (K+) has the electrical charge 1.
The NO3 polyatomic anion has a charge of 1-. Writing (NO3)3 means there are 3 such anions, each with a 1- charge, or a total charge of 3-. An example of this might be in the compound aluminum nitrate, Al(NO3)3.
According to the endless studying I have done in college involving chemistry, NO3 which is called nitrate has a negative charge of 1 or written as -1. If you need help remembering the charge, just think of nitric acid ( HNO3) where the Hydrogen has a positive 1 charge, which means the NO3 has to have a -1 charge.
When HNO3 dissolves in water, it forms H+ and NO3- ions. The total charge of the solution remains neutral because for each H+ ion formed, there is a corresponding NO3- ion formed. The sum of positive and negative charges in the solution cancels out, resulting in an overall neutral charge.
-1 or -2 i cant remember but im pretty sure -1.
The ion charge of nitrate (NO3-) is determined by the charges of its constituent atoms. Nitrogen typically has a charge of +5 and each oxygen has a charge of -2, resulting in a total charge of -1 for the nitrate ion.
The charge on iron in Fe(NO3)3 is +3. This is because nitrate (NO3) has a charge of -1, and there are three nitrate ions in the compound, making the total negative charge -3. In order for the compound to be neutral, the iron ion must have a charge of +3.
H+1 and NO3-1 produce nitric acid. The two charges cancel so the compound has a net charge of 0.
Example #1 - write the name for Fe(NO3)2 Step #1 - decide if the cation is one showing variable charge. If so, a Roman numeral will be needed. In this case, iron does show variable charge. If a variable charge cation is involved, you must determine the Roman numeral involved. You do this by computing the total charge contributed by the polyatomic ion. In this case, NO3¯ has a minus one charge and there are two of them, making a total of minus 2. Therefore, the iron must be a positive two, in order to keep the total charge of the formula at zero. Step #2 - determine the name of the polyatomic ion. Nitrate is the name of NO3¯. The correct name is iron(II) nitrate. The common name would be ferrous nitrate.
No, cyanide (CN-) is actually an anion with a negative charge. It is composed of a carbon atom bonded to a nitrogen atom with a single electron, which gives the molecule a negative charge.
NI(NO3)3+pbbr4nibr3+pb(no3)4
A charged atom is an ion: cation (positive electrical charge) or anion (negative electrical charge). Cations: H+, Na+, Ca2+ Anions: OH-, (SO4)2-, (NO3)-
The charges of NaNO3 break down as follows: Na has a charge of +1 because it loses one electron to become stable, and NO3 has a charge of -1 because it gains one electron to achieve stability. This results in NaNO3 having an overall neutral charge.