answersLogoWhite

0

Anaerobic.

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

Anaerobic respiration requires low levels of oxygen?

Anaerobic respiration occurs only in the absence of O2. When O2 is present, aerobic processes take over; so it can be said that O2 'poisons' anaerobic biochemistry.


What is the process of breaking down sugars in the presence of oxygen?

aerobic respiration basically its first step is called glycolysis and is further divded in two forms either aerobic which occur in presence of o2 and anaerobic in absences of oxygen Exactly so to answer the question the process the REQUIRES O2 is aerobic respiration like i said.


What is the process of taking in air into your body and giving it out is called?

Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O


How do photosynthesis and respiration take part in O2 cycle?

During photosynthesis O2 is released by the photolysis of water whereas in respiration O2 is consumed in the breakdown of substrate(reserve food).In simple words , Photosynthesis release O2 while respiration requires O2.


Which processes are aerobic and anaerobic?

· An anaerobic process It is the metabolic process that requires no oxygen to generate energy for example respiration in the absence of O2 is called anaerobic respiration.


Difference between Aerobic and Anerobic Activity?

Aerobic : If respiration takes place in the presence of O2, then it is called aerobic respiration/ aerobic activity. Eg: Plants and animals, protozoans, some bacteriaAnaerobic: IF respiration takes place in the absence of O2, then it is called anaerobic respiration/ anaerobic activity. Eg: Yeast, some bacteria


What carries on anaerobic respiration?

Anaerobic respiration in humans carries on in the cytoplasm of cells when oxygen is scarce, producing lactic acid as a byproduct. In yeast and some microorganisms, anaerobic respiration produces ethanol or other byproducts.


When o2 is not present to which compound is pyruvic acid converted?

In the absence of oxygen, pyruvic acid is converted into lactic acid through a process called lactic acid fermentation. This process helps regenerate NAD+ so that glycolysis can continue in the absence of oxygen.


What compound is released in cellular respiration?

Oxygen (O2) is released by photosynthesis during the light reaction and is used in cellular respiration. Photo. = Light energy + CO2 + Water -----> Carbohydrate + O2 Resp. = Carbohydrate + O2 -----> Energy + CO2 + Water


How are photosynthesis and cellular respiration opposite processes?

Photosynthesis: CO2 + H2O --> C6H12O6 + O2 Cellular Respiration: C6H12O6 + O2 --> CO2 + H2O reactants and products are switched


Cellular respiration occurs in the presence of?

Oxygen. O2.


What do plants make that animals need for respiration?

O2