0
What else can I help you with?
Related Questions
What year did the vietnom war start?
1961
How did vietnom war get its name?
From the nation it was fought in, Vietnam.
Who the president fearing the vietnom war?
Johnson hated the war the most, Nixon was the most angry.
How did John Lennon feel about the vietnom war?
John Lennon was opposed to the Vietnam Conflict.
In the US during the vietnom war television was instrumental in?
Promoting understanding between American and the Vietnamese.
What monument was the people in washington d.c. who died during the war of vietnom?
The wall and my great uncle is on it
What countries were in the vietnom war?
US, Australia, N. Zealand, S. Korea, S. Vietnam, Philippines, Thailand vs North Vietnam (supplied by USSR/Red China).
Who won the war in 1860?
who won the war was linclon
What sea will you cross if you travel from the phillipenes to vietnom?
From the South Chinese Sea/ South China Sea
Is there going to be a cod mw3?
Yes it is available for preorder and will be released on November 8 2011 well the next 1 is definetly gonna be on vietnom since theve only done WW2 but the game after vietnom will probably MW3 cuz it wuz such a big hit
Who won the war on terrorism?
Can the global War on Terrorism be won
In the vietnamise war who won?
The North side won the war
Trending Questions
A list of sites to meet friends?
What is the correct spelling of DNA?
Dose Iran have a good economy?
Does rubber cement dry clear when applied to paper?
What is the value of marlin firearms 22cal.model 81-dl?
What does fam mean?
What is the meaning of morose?
What is hamm in spanish?
What do flowers look like?
What type of training does a DO receive?
What is the capital of the state in which the first team plays in?
What number is a common multiple of 28 and 34?
Hod did World War 2 happen?
What first lady of the 1980's was shocked to find a rat swimming with her in the White House pool?
What authors have the initials SH?
How can you make your honey crystallize?
Why do you feel like you are being followed?
What does the word hone mean?
How much horsepower does a Yamaha 700 raptor have?
What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.