0
What else can I help you with?
Related Questions
Woms are harmfull or helpfull or both?
harmfull
Are alpacas harmfull?
Alpacas are not harmfull. They are very gentle
How are fossil fuels harmfull?
it is harmfull because it can kill people around the world
The correct name for NO3?
NO3 is known as nitrate.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
Are all bacteria harmfull?
no
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Is the pimple on my tattoo harmfull?
It is normal
Are snails harmfull?
no snails are not harmful.
Trending Questions
What benefits did Jay's Treaty give the US?
How do you replace peugeot 106 heater fan?
Why isn't kristin alfonso who plays hope brady on Days of Our Lives listed?
Do shay buckeey Johnson have kids?
What was Robert E. Lee's favorite subject in school?
Why do we celebrate the queens birthday?
What part of India speaks Lithuanian?
What disease did benny have in George Lopez episode feel the burn?
What can happen when you get osteoporosis?
Why was Helen Keller a political activist?
What is the population of kingsport?
What transport did they have in the 1800s?
Sponge is compressible still its solidwhy?
In runescape what would be the best adamant weapon to wield with an attack of 35?
What cars do rich people drive?
Did King Charles II give the land to his brother after New Amsterdam surrendered?
How did Stalin destroy Russian orthodox religion?
Can you drill a hole in pyrex?
When was Legend of the Crystal Skull created?
What is the current minimum wage in San Mateo?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.