0
What else can I help you with?
Related Questions
Woms are harmfull or helpfull or both?
harmfull
Are alpacas harmfull?
Alpacas are not harmfull. They are very gentle
How are fossil fuels harmfull?
it is harmfull because it can kill people around the world
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
Are all bacteria harmfull?
no
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Is the pimple on my tattoo harmfull?
It is normal
Are snails harmfull?
no snails are not harmful.
Trending Questions
What inability to extend the leg would result from a loss of function?
If my daughter does not own a car and is not listed on my insurance policy can she drive friends cars and does their insurance cover any accident she may have?
What is the birth name of Ana Silvia Garza?
What are baseball player Brady Anderson's physical stats?
How did frankenstien die?
Can a convicted felon become a vet tech?
What where some of Genghis kahns significant accomplishments?
Is the best way to straighten steel metal with heat or cold?
What happens when you take insulin without having diabetes?
Why are there often severral different versions of software packages each with their own version number?
What are the piano chords to slipping into darkness by war?
Is it illegal to copy an art style?
What is a SICU nurse?
What is the density of mineral oil?
Can you have pets in Dungeons and Dragons?
Why the title is moonlight on manila bay?
Who is the tallest Ben 10 alien?
Has anyone ever been killed by a basking shark?
All rasta people smoke weed?
How do you wire Ashley furnace?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.