0
What else can I help you with?
Related Questions
Woms are harmfull or helpfull or both?
harmfull
Are alpacas harmfull?
Alpacas are not harmfull. They are very gentle
How are fossil fuels harmfull?
it is harmfull because it can kill people around the world
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
Are all bacteria harmfull?
no
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Is the pimple on my tattoo harmfull?
It is normal
Are snails harmfull?
no snails are not harmful.
Trending Questions
How do you unlock cars in dt racer?
What three languages are in Yiddish?
How much air do you need in your tires on a daewoo matiz?
Who are some famous asymmetrical artists?
Is my black molly pregnant or fat?
What is the difference between sales and cost of sales?
What type of taillight bulb does a 1999 Tacoma need and how do you replace it?
How strong are bulldogs?
What techniques does Cindy Sherman use?
Where is wally world?
What cities are the same latitude as Rochester NY?
Is cable-one fast enough for Netflix instant streaming?
Sample DATA FLOW DIagram for inventory management system?
What does a source IP address look like?
What is the engine oil capacity of a Caterpillar 257B skidsteer?
Is a lab blue heeler mix a good cattle dog?
Which piece of legislation most directly affected Georgia in the days prior to the revolution?
What are some eight letter words with 3rd letter C and 4th letter H and 5th letter I and 7th letter Z?
What is the average ACT score for math and reading?
What type of mathematics does a fire fighter use?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.