0
What else can I help you with?
Related Questions
Woms are harmfull or helpfull or both?
harmfull
Are alpacas harmfull?
Alpacas are not harmfull. They are very gentle
How are fossil fuels harmfull?
it is harmfull because it can kill people around the world
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
Are all bacteria harmfull?
no
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Is the pimple on my tattoo harmfull?
It is normal
Are snails harmfull?
no snails are not harmful.
Trending Questions
Where can one find a tutorial on sql?
Is a daisy bio tic or abiotic?
What country was Dollly the sheep born?
When was Doris DeHerdt born?
How do you defeat final boss in sonic rush adventure?
Where do you get rypherier in Pokemon diamond?
What is the difference between food crops and fodder crops?
How do you get money out of your trust when trustee refuses?
What item levels up a Pokemon by 1?
What is alchemy and what were the elements and goals of alchemists?
What phobia is the fear of burning alive?
Did Clay Walker die?
What is pants in French?
Why cooked rice tastes sweet and good but appears to be tasteless?
What is 'Etudies-tu les sciences politiques' when translated from French to English?
What year did Turkey join the central powers?
A group of organisms that can interbreed is called a?
How do you get into Vassar?
How do you remove front rotors from a 2003 Suzuki Aerio?
When was Pachaiyappa Mudaliar born?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.