0
What else can I help you with?
Related Questions
Woms are harmfull or helpfull or both?
harmfull
Are alpacas harmfull?
Alpacas are not harmfull. They are very gentle
How are fossil fuels harmfull?
it is harmfull because it can kill people around the world
The correct name for NO3?
NO3 is known as nitrate.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
Are all bacteria harmfull?
no
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Is the pimple on my tattoo harmfull?
It is normal
Are snails harmfull?
no snails are not harmful.
Trending Questions
What does thriskia mean in English?
What river forms part of the border between Namibia an South Africa?
Flirting with my ex boyfriend over text. But im seeing someone else now and have been for a year and a half. Is this a bad sign or just harmless fun?
Which cast is kapu belong to?
Can deer eat asparagus ends?
What does the Hebrew phrase agudas achim mean?
What is the difference in the 8th digit vin being C or E?
Where is number cylinder for ford Sho 3.4?
What are the branches of food science?
Do any famous people have birthday August tenth?
What does a simease cat eat?
Who teaches the children how to shoot their air rifles?
Where can I find the Ralph Lauren shorts with the logo all over them?
What are good names for a yellow fish?
How much does a phlebotomist make in new york?
If you factor with different numbers do you get the same prime factorization?
How do you use the word digressive in a sentence?
Do all members of the European union use the euro as their currency?
When is the date of mother's day?
What do thomas bradley harold washington and coleman young have in common?
Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.