0
What else can I help you with?
Related Questions
Woms are harmfull or helpfull or both?
harmfull
Are alpacas harmfull?
Alpacas are not harmfull. They are very gentle
How are fossil fuels harmfull?
it is harmfull because it can kill people around the world
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
Are all bacteria harmfull?
no
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Is the pimple on my tattoo harmfull?
It is normal
Are snails harmfull?
no snails are not harmful.
Trending Questions
What has the author Anna Quindlen written?
Is 86 a multiple of 4?
How metal music effect the brain?
What does a red painted curb mean?
What was the Production Budget for Life of Pi?
What countries were allies and enemies of Mohandas Gandhi?
What is the history of the Purdue fight song?
How can I replace fluorescent bulbs with LED lights in my home?
Why are ducks and butterflies and dolphins nature?
Where do you find all the comic on the playground do you get a comic in the fort for big nate's island in poptropica?
What online banks offer free checking?
What four rights that Canadians enjoy?
How long would it take you to drive 85 km at 60km per hour?
An apple with a mass of 0.95 kilograms hangs from a tree branch 3.0 meters above the ground What is the potential energy of the apple?
I dont feel like eating on my peirod Is it normal i only ate 1 meal?
What is the divisible by 310 in 5-10?
Did 5 people escape from Alcatraz?
What did the europeans think of the maori?
What year of Alvarez Professional Model 5022 serial 95040115?
How old do you have to be in order to become a bartender in IL?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.