0
What else can I help you with?
Related Questions
Woms are harmfull or helpfull or both?
harmfull
Are alpacas harmfull?
Alpacas are not harmfull. They are very gentle
How are fossil fuels harmfull?
it is harmfull because it can kill people around the world
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
Are all bacteria harmfull?
no
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Is the pimple on my tattoo harmfull?
It is normal
Are snails harmfull?
no snails are not harmful.
Trending Questions
What president is closely related to the building of the panama canal?
The United Nations forces were commanded by who during the cold war?
Who are internal customer?
What are the common names of the mugwort plant?
What fruit has 10 letters in its name and is very big?
What is the windiest place in south America?
What is gayle King's middle name?
What caused the peasant?
Who was malchezedek?
What is meant by '' crossing over'' in terms of cells in your body?
What is a state or teritory?
What is the difference between wild populations and natural populations?
What percentage of 191 is 32?
When listening to or reading a transcript of a speech you should make inferences about what?
How many pounds are in 187 kilograms?
Did the Burrow go on fire in the Harry Potter and the Half-Blood Prince book?
What is the main purpose of web crawler program?
What is 1000x1000?
What made Bayard Taylor write the Bedouin song?
What value Raymond Weil 9120?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.