The ion nitrate (NO3)- is toxic at higher levels.
harmfull
Alpacas are not harmfull. They are very gentle
it is harmfull because it can kill people around the world
NO3 is known as nitrate.
The molecular formula is Co(NO3)2Co(NO3)2
no
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
The formula for the nitrate ion is NO3 -1.
Chromium (III) Nitrate
NI(NO3)3+pbbr4nibr3+pb(no3)4
It is normal
no snails are not harmful.