0
What else can I help you with?
Related Questions
Woms are harmfull or helpfull or both?
harmfull
Are alpacas harmfull?
Alpacas are not harmfull. They are very gentle
How are fossil fuels harmfull?
it is harmfull because it can kill people around the world
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
Are all bacteria harmfull?
no
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Is the pimple on my tattoo harmfull?
It is normal
Are snails harmfull?
no snails are not harmful.
Trending Questions
How much paper do you need to recycle to save one tree?
What would decide weather slavery would be allowed in a territory idea of popular sovereignty?
Should you stop breastfeeding to enhance your chances of getting pregnant again?
How big does a cricket insect get?
When was Pico da Neblina National Park created?
What role would downsizing play in an organization's overall level of practical intelligence?
What causes the brake light to stay on in your 1986 Dodge D150?
Is 1600 even or odd?
Is Adidas in video games?
Where does floodplain form?
What nation's capital city is Budapest?
What are the boundary points of irrational numbers?
How many feet is an android charger compared to and iPhone charger?
Is Georgia LEDC?
Who was ava gardner's parent's?
What did the the Ancient Greek athletes wear in the Olympics?
What is Y10 bar weight per meter run?
In what culture did Hernándo Cortés grow up in?
Who was the first president to open a baseball season?
What rhymes with journey?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.