0
What else can I help you with?
Related Questions
Woms are harmfull or helpfull or both?
harmfull
Are alpacas harmfull?
Alpacas are not harmfull. They are very gentle
How are fossil fuels harmfull?
it is harmfull because it can kill people around the world
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
The correct name for NO3?
NO3 is known as nitrate.
Are all bacteria harmfull?
no
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Is the pimple on my tattoo harmfull?
It is normal
Are snails harmfull?
no snails are not harmful.
Trending Questions
How long is a piece of chalk in millimeters?
Horses lying down?
What is the grant that is considered the foundation of federal financial aid?
Who is Francis Ferdinand visits to?
How much does dom perignon cost?
Are Country roads as easy to drive as city streets?
Is the silver maple leaf pattern Pinnate palmate or parrallel?
What is the most accurate fraction for pi?
Where are all the Pokemon starter masks in Pokemon pearl?
Where do the sunspot appear?
Who is Shantel Chess?
Where can one find CD's by the Black Eyed Peas?
How often does the NFC east play the AFC west?
What does the suffix strat mean?
Where is block heater on 2002 F 350 7.3?
Are people worried about global warming where you live?
Why David decides to go untie Mr. Griffin?
What are 50 questions to ask your boyfriend?
Was rock Hudson married to Liz Taylor?
What provides the energy needed for muscle contraction?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.